Benzoic acid, 4-ethyl-, methyl ester → Methyl 4-(1-bromoethyl)benzoate

HRID 1654720

반응식

HRID 1654720 반응식
[CH2:1]([C:3]1[CH:12]=[CH:11][C:6]([C:7]([O:9][CH3:10])=[O:8])=[CH:5][CH:4]=1)[CH3:2].[Br:13]N1C(=O)CCC1=O>C(Cl)(Cl)(Cl)Cl.C1C(C(OOOC(=O)C2C=CC=CC=2)=O)=CC=CC=1>[Br:13][CH:1]([C:3]1[CH:12]=[CH:11][C:6]([C:7]([O:9][CH3:10])=[O:8])=[CH:5][CH:4]=1)[CH3:2]

참가 물질

5

반응물 2

HCID 23827Benzoic acid, 4-ethyl-, methyl esterHCID 67184N-bromobutanimide

생성물 1

HCID 12342351Methyl 4-(1-bromoethyl)benzoate수율 109.2%

시약·촉매·용매 2

HCID 53400210Perbenzoic anhydride촉매HCID 5943Carbon Tetrachloride용매

실험 절차

To a solution of methyl 4-ethylbenzoate (5.12 g) in carbon tetrachloride (50 ml) were added perbenzoic anhydride (0.20 g) and N-bromosuccinimide (6.07 g) in turn, and the mixture was heated and refluxed. After 30 minutes, the mixture was allowed to cool, and the precipitate was separated by filtration, and washed with carbon tetrachloride. The filtrate and the washings were combined, and concentrated under reduced pressure to give the title compound (8.28 g)

후처리

  1. temperaturethe mixture was heated
  2. temperaturerefluxed
  3. temperatureto cool
  4. customthe precipitate was separated by filtration
  5. washwashed with carbon tetrachloride
  6. concentrationconcentrated under reduced pressure

출처 및 근거

ORD 기록
ord-56ee622df6874019bb4d51d01fee57fe
출처 데이터셋
uspto-grants-1995_04
특허 번호
US05409928

연결된 노트

불러오는 중…