Ethanol → Dehydroabietic Acid

HRID 1744410

반응식

HRID 1744410 반응식
[CH3:1][CH:2]([C:4]1[CH2:13][CH2:12][C@H:11]2[C:6](=[CH:7][CH2:8][C@H:9]3[C@@:17]([C:19]([OH:21])=[O:20])([CH3:18])[CH2:16][CH2:15][CH2:14][C@@:10]32[CH3:22])[CH:5]=1)[CH3:3].CO.C(O)C.C(O)=CC>[Pd].C1C=CC=CC=1.C(O)(=O)C>[CH3:3][CH:2]([C:4]1[CH:13]=[CH:12][C:11]2[C@@:10]3([CH3:22])[CH2:14][CH2:15][CH2:16][C@:17]([C:19]([OH:21])=[O:20])([CH3:18])[C@@H:9]3[CH2:8][CH2:7][C:6]=2[CH:5]=1)[CH3:1]

참가 물질

8

반응물 4

HCID 702EthanolHCID 887MethanolHCID 10569Abietic AcidHCID 143500Hydroxypropylene

생성물 1

HCID 94391Dehydroabietic Acid

시약·촉매·용매 3

HCID 23938Palladium촉매HCID 176Acetic Acid용매HCID 241Benzene용매

실험 절차

said abietic acid at 200–300° C. for 1–5 hours with the catalyst of 0.1–5% (wt) of 5%–10% palladium/carbon, or incubating directly at 220–380° C. After incubation and cooling down, adding 0.5 to 10-fold (volume) solvent, said solvent can be any one of methanol, ethanol, propenol, acetyester acetic acid, benzene and methbenzene, keeping refluxed for 1–3 hours, filtering when it is warm, cooling down, allowing it to stand for overnight and be crystallized. Dehydroabietic acid is obtained after filtering.

후처리

  1. customat 200–300° C.
  2. customfor 1–5 hours
  3. customincubating directly at 220–380° C
  4. temperatureAfter incubation and cooling down
  5. additionadding 0.5 to 10-fold (volume) solvent
  6. temperaturekeeping refluxed for 1–3 hours
  7. filtrationfiltering when it
  8. temperatureis warm
  9. temperaturecooling down
  10. custombe crystallized

출처 및 근거

ORD 기록
ord-a674de46ce834a52b48eb19e4e6e755e
출처 데이터셋
uspto-grants-2006_03
특허 번호
US07015343B2

연결된 노트

불러오는 중…