Water → 6-Benzofuranacetonitrile

HRID 1758261노트

반응식

HRID 1758261 반응식
Br[CH2:2][C:3]1[CH:11]=[CH:10][C:6]2[CH:7]=[CH:8][O:9][C:5]=2[CH:4]=1.[C-:12]#[N:13].[Na+].O>[Br-].C([N+](CCCC)(CCCC)CCCC)CCC.ClCCl>[O:9]1[C:5]2[CH:4]=[C:3]([CH2:2][C:12]#[N:13])[CH:11]=[CH:10][C:6]=2[CH:7]=[CH:8]1

참가 물질

6

반응물 3

HCID 962WaterHCID 8929Sodium CyanideHCID 2050997979444-77-2

생성물 1

HCID 126007356-Benzofuranacetonitrile수율 93.8%

시약·촉매·용매 2

HCID 74236Tetrabutylammonium Bromide촉매HCID 6344Dichloromethane용매

실험 절차

A mixture of 6-bromomethylbenzofuran (4.38 g, 0.021 mol), sodium cyanide (2.0 g, 0.041 mol), tetrabutylammonium bromide (0.42 g, 0.0013 mol), water (15 cm3) and dichloromethane (15 cm3) was stirred vigorously for 18 hr. The mixture was separated and the organic layer was washed with water, dried (Na2SO4), filtered and the solvent was removed. The residue was extracted with petroleum ether (b.p. 60°-80° C.), and the solvent was removed to give benzofuran-6-acetonitrile (3.09 g, 0.0197 mol), 93.7%) as an oil, t.l.c./silica/toluene, RF 0.21.

후처리

  1. customThe mixture was separated
  2. washthe organic layer was washed with water
  3. dry with materialdried (Na2SO4)
  4. filtrationfiltered
  5. customthe solvent was removed
  6. extractionThe residue was extracted with petroleum ether (b.p. 60°-80° C.)
  7. customthe solvent was removed

출처 및 근거

ORD 기록
ord-c05139bc217742158e9c12201ca87eb7
출처 데이터셋
uspto-grants-1983_02
특허 번호
US04372970

반응 노트

불러오는 중…