N-bromobutanimide → 4-(3-Cyano-2-thienyl)benzyl bromide

HRID 1769203노트

반응식

HRID 1769203 반응식
[CH3:1][C:2]1[CH:7]=[CH:6][C:5]([C:8]2[S:9][CH:10]=[CH:11][C:12]=2[C:13]#[N:14])=[CH:4][CH:3]=1.[Br:15]N1C(=O)CCC1=O>C(Cl)(Cl)(Cl)Cl.N1(C2CCCCCCCC2)CCCCCCCC1>[Br:15][CH2:1][C:2]1[CH:3]=[CH:4][C:5]([C:8]2[S:9][CH:10]=[CH:11][C:12]=2[C:13]#[N:14])=[CH:6][CH:7]=1

참가 물질

5

반응물 2

HCID 67184N-bromobutanimideHCID 200928362-(4-Methylphenyl)thiophene-3-carbonitrile

생성물 1

HCID 200928574-(3-Cyano-2-thienyl)benzyl bromide수율 67.1%

시약·촉매·용매 2

HCID 18706763HCID 18706763, 화합물촉매HCID 5943Carbon Tetrachloride용매

실험 절차

A mixture of 2-(4-methylphenyl)-3-cyanothiophene (1.5 g, 7.5 mmol), N-bromosuccinimide (1.34 g, 7.5 mmol), and azabicyclononane (20 mg) in carbon tetrachloride was irradiated with UV light for one hour. The reaction mixture was cooled, and the solid filtered off. The filtrate was concentrated, and the residue purified by flash chromatography, eluting with 5% ethyl acetate/hexane, to yield 2-(4-bromomethylphenyl)-3-cyanothiophene 1.4 g, m.p. 68-75 (slightly impure, used as such).

후처리

  1. customwas irradiated with UV light for one hour
  2. temperatureThe reaction mixture was cooled
  3. filtrationthe solid filtered off
  4. concentrationThe filtrate was concentrated
  5. customthe residue purified by flash chromatography
  6. washeluting with 5% ethyl acetate/hexane

출처 및 근거

ORD 기록
ord-70b25ef575a847cf88367ef29622c2c9
출처 데이터셋
uspto-grants-1995_01
특허 번호
US05380739

반응 노트

불러오는 중…