Phenacyl bromide → HCID 178444626, 화합물

HRID 1812462

반응식

HRID 1812462 반응식
C#CCCCCC=O.c1ccc(C(=O)CBr)cc1>C[Si](C)(C)OC(c1ccccc1)(c1ccccc1)[C@@H]1CCCN1.C1=CC=C([C-]=C1)C2=CC=CC=N2.C1=CC=C([C-]=C1)C2=CC=CC=N2.C1=CC=NC(=C1)C2=CC=CC=N2.F[P-](F)(F)(F)(F)F.[Ir+3].CN(C)C=O.Cc1cccc(C)n1>C#CCCC[C@@H](C=O)CC(=O)c1ccccc1.C#CCCC[C@H](C=O)CC(=O)c1ccccc1

참가 물질

8

반응물 3

HCID 6259Phenacyl bromideHCID 79372,6-LutidineHCID 11355455Hept-6-ynal

생성물 2

HCID 178444626HCID 178444626, 화합물HCID 178444627HCID 178444627, 화합물

시약·촉매·용매 3

HCID 11198150(S)-(-)-alpha,alpha-Diphenyl-2-pyrrolidinemethanol Trimethylsilyl Ether촉매HCID 54589530Iridium(3+);2-phenylpyridine;2-pyridin-2-ylpyridine;hexafluorophosphate촉매HCID 6228Dimethylformamide용매5회

반응 조건

온도
22 °C

후처리

  1. aliquot4 uL mixture of each reacted solution was collected and diluted with 36 uL ACN
  2. addition4 uL mixture of each reacted solution was collected and diluted with 36 uL ACN
  3. additionchiral resolving regent (150 mM in DCM, 40 uL)
  4. additionCuI with DIPEA (400 mM in ACN) 40 uL
  5. additioninternal standard 1-phenylprop-2-yn-1-ol (4) (25 mM in ACN) 40 uL
  6. stirring기록된 절차가 없습니다
  7. aliquotAfter the reaction, 10 uL of supernatant for each reaction was transferred to another 96-well plate
  8. additionAfter the reaction, 10 uL of supernatant for each reaction was transferred to another 96-well plate and diluted with 190 uL ACN before the IM-MS analysis

출처 및 근거

ORD 기록
ord-39c15bc55a044d5eb2628f70a1588d15
출처 데이터셋
Dataset from `Ultra-high-throughput mapping of the chemical space of asymmetric catalysis enables accelerated reaction discovery`

연결된 노트

불러오는 중…