1,4-Dioxane → HCID 22504414, 화합물

HRID 1814092

반응식

HRID 1814092 반응식
C[Si]([C:5]#[C:6][C:7]1[CH:8]=[N:9][CH:10]=[CH:11][CH:12]=1)(C)C.[C:13]1([S:19]([NH:22][C:23]2[C:28](I)=[CH:27][C:26]([S:30]([CH3:33])(=[O:32])=[O:31])=[CH:25][CH:24]=2)(=[O:21])=[O:20])[CH:18]=[CH:17][CH:16]=[CH:15][CH:14]=1.C([O-])(=O)C.[K+].O1CCOCC1>Cl[Pd](Cl)([P](C1C=CC=CC=1)(C1C=CC=CC=1)C1C=CC=CC=1)[P](C1C=CC=CC=1)(C1C=CC=CC=1)C1C=CC=CC=1.C(OCC)(=O)C.O>[C:13]1([S:19]([N:22]2[C:23]3[C:24](=[CH:25][C:26]([S:30]([CH3:33])(=[O:32])=[O:31])=[CH:27][CH:28]=3)[CH:5]=[C:6]2[C:7]2[CH:8]=[N:9][CH:10]=[CH:11][CH:12]=2)(=[O:20])=[O:21])[CH:14]=[CH:15][CH:16]=[CH:17][CH:18]=1

참가 물질

8

반응물 4

HCID 312751,4-DioxaneHCID 517044Potassium AcetateHCID 41008573-(Trimethylsilylethynyl)pyridineHCID 22504376HCID 22504376, 화합물

생성물 1

HCID 22504414HCID 22504414, 화합물수율 63%

시약·촉매·용매 3

HCID 178418476HCID 178418476, 화합물촉매HCID 962Water용매HCID 8857Ethyl Acetate용매

반응 조건

온도
100 °C

실험 절차

A mixture of 3-trimethylsilylethynylpyridine (1.07 g), 2-benzenesulfonylamino-3-iodo-5-methanesulfonylbenzene (1.75 g), potassium acetate (1.60 g), cuprous iodide (60 mg), dichlorobis(triphenylphosphine)palladium (0.20 g) and 1,4-dioxane (4 ml) was stirred at 100° C. for 12 hours under nitrogen atmosphere. To the reaction solution were added water and ethyl acetate. The insolubles were filtered off. The filtrate was extracted with ethyl acetate, dried over anhydrous sodium sulfate, filtered and concentrated under reduced pressure. The resulting residue was subjected to silica gel column chromatography (hexane:ethyl acetate=1:3) to obtain 1.04 g of the desired product.

후처리

  1. filtrationThe insolubles were filtered off
  2. extractionThe filtrate was extracted with ethyl acetate
  3. dry with materialdried over anhydrous sodium sulfate
  4. filtrationfiltered
  5. concentrationconcentrated under reduced pressure

출처 및 근거

ORD 기록
ord-fc99351053ee40dc8d49b302f8fd0440
출처 데이터셋
uspto-grants-2005_04
특허 번호
US06875770B2

연결된 노트

불러오는 중…