Acetic Acid → 4,4'-Dihydroxy-3-biphenylcarboxylic acid

HRID 1838785노트

반응식

HRID 1838785 반응식
[OH:1][C:2]1[CH:7]=[CH:6][C:5]([C:8]2[CH:13]=[CH:12][C:11]([O:14]C)=[CH:10][CH:9]=2)=[CH:4][C:3]=1[C:16]([OH:18])=[O:17].C(O)(=O)C.Br>[Br-].C([P+](CCCC)(CCCC)CCCC)CCC.O>[OH:1][C:2]1[CH:7]=[CH:6][C:5]([C:8]2[CH:9]=[CH:10][C:11]([OH:14])=[CH:12][CH:13]=2)=[CH:4][C:3]=1[C:16]([OH:18])=[O:17]

참가 물질

6

반응물 3

HCID 176Acetic AcidHCID 260Hydrogen BromideHCID 51971334-Hydroxy-4′-methoxy[1,1′-biphenyl]-3-carboxylic acid

생성물 1

HCID 234484124,4'-Dihydroxy-3-biphenylcarboxylic acid수율 48.3%

시약·촉매·용매 2

HCID 76564Tetrabutylphosphonium bromide촉매HCID 962Water용매

실험 절차

A solution of 4-hydroxy-4′-methoxy-3-biphenylcarboxylic acid (5.3 g; 21.6 mmol), tetrabutylphosphonium bromide (0.8 g; 2.3 mmol), acetic acid (35 ml) and hydrobromic acid (35 ml of a 48% solution) was heated at reflux for 6 h. The reaction mixture was cooled and poured into water (400 ml). The resulting precipitate was isolated and recrystallised from ethyl acetate to give 2.4 g (47%) of 4,4′-dihydroxy-3-biphenyl-carboxylic acid.

후처리

  1. temperatureat reflux for 6 h
  2. temperatureThe reaction mixture was cooled
  3. customThe resulting precipitate was isolated
  4. customrecrystallised from ethyl acetate

출처 및 근거

ORD 기록
ord-a8468112a53940b59cdcc25b28d54e59
출처 데이터셋
uspto-grants-2004_01
특허 번호
US06676851B1

반응 노트

불러오는 중…