Methyl behenate → (2-Morpholinoethyl) behenate

HRID 1865768

반응식

HRID 1865768 반응식
[C:1]([O:24][CH3:25])(=[O:23])[CH2:2][CH2:3][CH2:4][CH2:5][CH2:6][CH2:7][CH2:8][CH2:9][CH2:10][CH2:11][CH2:12][CH2:13][CH2:14][CH2:15][CH2:16][CH2:17][CH2:18][CH2:19][CH2:20][CH2:21][CH3:22].[O:26]1[CH2:31][CH2:30][N:29]([CH2:32]CO)[CH2:28][CH2:27]1>C[O-].[Na+].C1(C)C=CC=CC=1>[C:1]([O:24][CH2:25][CH2:32][N:29]1[CH2:30][CH2:31][O:26][CH2:27][CH2:28]1)(=[O:23])[CH2:2][CH2:3][CH2:4][CH2:5][CH2:6][CH2:7][CH2:8][CH2:9][CH2:10][CH2:11][CH2:12][CH2:13][CH2:14][CH2:15][CH2:16][CH2:17][CH2:18][CH2:19][CH2:20][CH2:21][CH3:22]

참가 물질

5

반응물 2

HCID 13584Methyl behenateHCID 611632-Morpholinoethanol

생성물 1

HCID 66705417(2-Morpholinoethyl) behenate수율 91%

시약·촉매·용매 2

HCID 10942334Sodium Methoxide촉매HCID 1140Toluene용매

실험 절차

A mixture of 35.5 g of methyl behenate (18), 19.7 g of 2-morpholinoethanol (17), 270 mg of sodium methoxide and 150 g of toluene was heated under reflux for 6 hours while distilling off the methanol resulting from the reaction. The reaction solution was cooled. By standard aqueous work-up and distilling off toluene, 41.3 g of (2-morpholinoethyl) behenate (Quencher 2) was obtained (yield 91%).

후처리

  1. temperaturewas heated
  2. temperatureunder reflux for 6 hours
  3. distillationwhile distilling off the methanol resulting
  4. customfrom the reaction
  5. temperatureThe reaction solution was cooled
  6. distillationBy standard aqueous work-up and distilling off toluene

출처 및 근거

ORD 기록
ord-a386f213e6bd46459c2ea17f0bb9ba1b
출처 데이터셋
uspto-grants-2009_12
특허 번호
US07629108B2

연결된 노트

불러오는 중…