P,P-Bis(3-nitrophenyl)phosphinic acid → Phosphinic acid, bis(m-aminophenyl)-

HRID 1890129노트

반응식

HRID 1890129 반응식
[N+:1]([C:4]1[CH:5]=[C:6]([P:10]([C:13]2[CH:18]=[CH:17][CH:16]=[C:15]([N+:19]([O-])=O)[CH:14]=2)(=[O:12])[OH:11])[CH:7]=[CH:8][CH:9]=1)([O-])=O.[H][H]>CO.[Pt]>[NH2:1][C:4]1[CH:5]=[C:6]([P:10]([C:13]2[CH:18]=[CH:17][CH:16]=[C:15]([NH2:19])[CH:14]=2)(=[O:11])[OH:12])[CH:7]=[CH:8][CH:9]=1

참가 물질

5

반응물 2

HCID 29143P,P-Bis(3-nitrophenyl)phosphinic acidHCID 178418361HCID 178418361, 화합물

생성물 1

HCID 213222Phosphinic acid, bis(m-aminophenyl)-

시약·촉매·용매 2

HCID 23939Platinum촉매HCID 887Methanol용매

실험 절차

The compound bis(3-nitrophenyl)phosphinic acid (14.0 g, 45.4 mmol) from Example 1 was suspended in methanol (200 ml). Platinum (5 wt. %, on activated carbon, 1.4 g) was added. The mixture was shaken on a hydrogenation apparatus (50 psi) until no further hydrogen consumption was observed. The mixture was filtered through celite and then evaporated to dryness. The solid obtained (9.87 g, 88%) was used without purification. The structure of bis(3-aminophenyl)phosphinic acid is:

후처리

  1. filtrationThe mixture was filtered through celite
  2. customevaporated to dryness
  3. customThe solid obtained (9.87 g, 88%)
  4. customwas used without purification

출처 및 근거

ORD 기록
ord-67f9ed4dc73e4c928c076c710c41015b
출처 데이터셋
uspto-grants-2013_08
특허 번호
US08506655B1

반응 노트

불러오는 중…