Ethanol → Ethyl N-phenylcarbamate

HRID 2166655

반응식

HRID 2166655 반응식
[NH2:1][C:2]1[CH:7]=[CH:6][CH:5]=[CH:4][CH:3]=1.C(N[C:11](=[O:13])[O-:12])C.[CH2:14](O)[CH3:15]>CCCCCCCC([O-])=O.CCCCCCCC([O-])=O.[Zn+2]>[CH2:14]([O:12][C:11](=[O:13])[NH:1][C:2]1[CH:7]=[CH:6][CH:5]=[CH:4][CH:3]=1)[CH3:15]

참가 물질

5

반응물 3

HCID 702EthanolHCID 6115AnilineHCID 22042200N-ethylcarbamate

생성물 1

HCID 7591Ethyl N-phenylcarbamate

시약·촉매·용매 1

HCID 11180Zinc Caprylate촉매

실험 절차

1024 g aniline, 980 g ethylcarbamate, 1060 g ethanol (approximately 96%) and 6.0 g zinc octoate were reacted in the apparatus described in Example 1 for 6.5 hours at 200° C. When the apparatus had cooled and the pressure had been reduced, the reaction mixture was removed, filtered and analyzed by high pressure liquid chromatography (HPLC). A yield of 1580 g (87% of the theoretical yield) of N-phenyl-carbamic acid-ethyl ester was obtained.

후처리

  1. temperatureWhen the apparatus had cooled
  2. customthe reaction mixture was removed
  3. filtrationfiltered

출처 및 근거

ORD 기록
ord-1ac35093fd3a4e02b6a51f967d1317ef
출처 데이터셋
uspto-grants-1983_06
특허 번호
US04388238

연결된 노트

불러오는 중…