Hydrogen Bromide → 2-Amino-5-bromo-1H-pyrrole-3,4-dicarbonitrile

HRID 2175723노트

반응식

HRID 2175723 반응식
[C:1]([C:3]([C:9]#[N:10])=[C:4]([C:7]#[N:8])[C:5]#[N:6])#[N:2].[BrH:11]>CC(C)=O.C(OCC)(=O)C.C(O)(=O)C>[NH2:2][C:1]1[NH:6][C:5]([Br:11])=[C:4]([C:7]#[N:8])[C:3]=1[C:9]#[N:10]

참가 물질

6

반응물 2

HCID 260Hydrogen BromideHCID 12635Tetracyanoethylene

생성물 1

HCID 6109782-Amino-5-bromo-1H-pyrrole-3,4-dicarbonitrile수율 66.8%

시약·촉매·용매 3

HCID 176Acetic Acid용매HCID 180Acetone용매HCID 8857Ethyl Acetate용매

실험 절차

Tetracyanoethylene (10.02 g, 78.23 mmol) was dissolved in the mixed solvent of acetone (60 mL) and ethyl acetate (120 mL), to which hydrogen bromide (33 wt %, 60 mL) dissolved in acetic acid was added at 0˜5° C. The yellow solid compound observed after one hour-stirring was isolated by filtering. After washing the compound with cold distilled water (100 mL), the mixture was dried in the air to give the target compound (11.02 g, 52.22 mmol, 66.8%).

후처리

  1. additionwas added at 0˜5° C
  2. customwas isolated
  3. filtrationby filtering
  4. washAfter washing the compound
  5. distillationwith cold distilled water (100 mL)
  6. customthe mixture was dried in the air

출처 및 근거

ORD 기록
ord-d6d498be3d55433a8bde26539f9937fe
출처 데이터셋
uspto-grants-2015_06
특허 번호
US09062088B2

반응 노트

불러오는 중…