Tert-Butylamine → 6'-[2-allyl-6-({4-[(tert-butylamino)methyl]phenyl}amino)-3-oxo-2,3-dihydro-1H-pyrazolo[3,4-d]pyrimidin-1-yl]-2H-1,2'-bipyridin-2-one

HRID 2191911

반응식

HRID 2191911 반응식
ClCS(O)(=O)=O.[CH2:7]([N:10]1[C:18](=[O:19])[C:17]2[C:12](=[N:13][C:14]([NH:20][C:21]3[CH:26]=[CH:25][C:24]([CH2:27]O)=[CH:23][CH:22]=3)=[N:15][CH:16]=2)[N:11]1[C:29]1[N:34]=[C:33]([N:35]2[CH:40]=[CH:39][CH:38]=[CH:37][C:36]2=[O:41])[CH:32]=[CH:31][CH:30]=1)[CH:8]=[CH2:9].[C:42]([NH2:46])([CH3:45])([CH3:44])[CH3:43].C(=O)([O-])O.[Na+]>C(Cl)(Cl)Cl.C(N(CC)CC)C.O1CCCC1>[CH2:7]([N:10]1[C:18](=[O:19])[C:17]2[C:12](=[N:13][C:14]([NH:20][C:21]3[CH:22]=[CH:23][C:24]([CH2:27][NH:46][C:42]([CH3:45])([CH3:44])[CH3:43])=[CH:25][CH:26]=3)=[N:15][CH:16]=2)[N:11]1[C:29]1[N:34]=[C:33]([N:35]2[CH:40]=[CH:39][CH:38]=[CH:37][C:36]2=[O:41])[CH:32]=[CH:31][CH:30]=1)[CH:8]=[CH2:9]

참가 물질

8

반응물 4

HCID 6385Tert-ButylamineHCID 187807Chloromethanesulfonic acidHCID 516892Sodium BicarbonateHCID 684257146'-[2-allyl-6-{[4-(hydroxymethyl)phenyl]amino}-3-oxo-2,3-dihydro-1H-pyrazolo[3,4-d]pyrimidin-1-yl]-2H-1,2'-bipyridin-2-one

생성물 1

HCID 426027676'-[2-allyl-6-({4-[(tert-butylamino)methyl]phenyl}amino)-3-oxo-2,3-dihydro-1H-pyrazolo[3,4-d]pyrimidin-1-yl]-2H-1,2'-bipyridin-2-one

시약·촉매·용매 3

HCID 6212Chloroform용매HCID 8028Tetrahydrofuran용매HCID 8471Triethylamine용매

실험 절차

Chloromethanesulfonic acid (37 μL) was added to a tetrahydrofuran solution (10 mL) of 6′-[2-allyl-6-{[4-(hydroxymethyl)phenyl]amino}-3-oxo-2,3-dihydro-1H-pyrazolo[3,4-d]pyrimidin-1-yl]-2H-1,2′-bipyridin-2-one (110 mg) and triethylamine (164 μL), and stirred at room temperature for 1 hour, then tert-butylamine (500 μL) was added to the reaction liquid, and stirred for 6 hours. Chloroform and aqueous sodium hydrogencarbonate solution were added to the reaction liquid, and the organic layer was separated. The organic layer was washed with saturated saline water, then dried with anhydrous magnesium sulfate, filtered, the solvent was evaporated away, and the resulting crude product was purified through basic silica gel column chromatography (hexane-ethyl acetate/ethanol (19/1) mixture) to give the entitled compound as a white solid substance (9.2 mg).

후처리

  1. stirringstirred for 6 hours
  2. customthe organic layer was separated
  3. washThe organic layer was washed with saturated saline water
  4. dry with materialdried with anhydrous magnesium sulfate
  5. filtrationfiltered
  6. customthe solvent was evaporated away
  7. customthe resulting crude product was purified through basic silica gel column chromatography (hexane-ethyl acetate/ethanol (19/1) mixture)

출처 및 근거

ORD 기록
ord-9e476de24e9940eebec54aafc483b0dd
출처 데이터셋
uspto-grants-2012_12
특허 번호
US08329711B2

연결된 노트

불러오는 중…