Azobisisobutyronitrile → 4-Acetylthio-1,1-bis(trifluoromethyl)-1-butanol

HRID 2218569

반응식

HRID 2218569 반응식
[F:1][C:2]([F:13])([F:12])[C:3]([C:8]([F:11])([F:10])[F:9])([OH:7])[CH2:4][CH:5]=[CH2:6].[C:14]([OH:17])(=[S:16])[CH3:15].CC(N=NC(C#N)(C)C)(C#N)C>N(C(C)(C)C#N)=NC(C)(C)C#N.O1CCOCC1>[C:14]([S:16][CH2:6][CH2:5][CH2:4][C:3]([C:8]([F:9])([F:10])[F:11])([C:2]([F:12])([F:13])[F:1])[OH:7])(=[O:17])[CH3:15]

참가 물질

6

반응물 3

HCID 6547Azobisisobutyronitrile2회HCID 3288704-Penten-2-ol, 1,1,1-trifluoro-2-(trifluoromethyl)-HCID 178418634HCID 178418634, 화합물2회

생성물 1

HCID 865942984-Acetylthio-1,1-bis(trifluoromethyl)-1-butanol수율 80%

시약·촉매·용매 2

HCID 6547Azobisisobutyronitrile촉매HCID 312751,4-Dioxane용매

실험 절차

Under a nitrogen atmosphere, 20 g of 4,4-bis(trifluoromethyl)-4-hydroxy-1-butene (96.1 mmol), 8.05 g of thioacetic acid (105.7 mmol), 60 g of 1,4-dioxane and 0.79 g of 2,2′-azobisisobutyronitrile (hereinafter abbreviated as AIBN) (4.8 mmol) were put into a flask equipped with a stirring bar, a thermometer and a condenser, and heated with stirring. During the reaction, thioacetic acid and AIBN were appropriately added and after confirming that a substrate was completely consumed, the reaction solution was distilled as it was under reduced pressure to yield an intermediate product, 22 g of 4-acetylthio-1,1-bis(trifluoromethyl)-1-butanol (76.9 mmol).

후처리

  1. customwere put into a flask
  2. customequipped with a stirring bar
  3. temperaturea thermometer and a condenser, and heated
  4. additionwere appropriately added
  5. customwas completely consumed
  6. distillationthe reaction solution was distilled as it

출처 및 근거

ORD 기록
ord-eb970c3d5fb043828d0f48b16c0cc4b5
출처 데이터셋
uspto-grants-2008_08
특허 번호
US07411097B2

연결된 노트

불러오는 중…