N-bromobutanimide → 5-[4-(Bromomethyl)phenyl]-2-ethyl-1,2,3,4-tetraazole

HRID 2245319노트

반응식

HRID 2245319 반응식
[CH2:1]([N:3]1[N:7]=[N:6][C:5]([C:8]2[CH:13]=[CH:12][C:11]([CH3:14])=[CH:10][CH:9]=2)=[N:4]1)[CH3:2].[Br:15]N1C(=O)CCC1=O>C(Cl)(Cl)(Cl)Cl.C(OOC(=O)C1C=CC=CC=1)(=O)C1C=CC=CC=1>[Br:15][CH2:14][C:11]1[CH:12]=[CH:13][C:8]([C:5]2[N:6]=[N:7][N:3]([CH2:1][CH3:2])[N:4]=2)=[CH:9][CH:10]=1

참가 물질

5

반응물 2

HCID 67184N-bromobutanimideHCID 207099322-Ethyl-5-(4-methylphenyl)-1,2,3,4-tetraazole

생성물 1

HCID 686826535-[4-(Bromomethyl)phenyl]-2-ethyl-1,2,3,4-tetraazole수율 103.7%

시약·촉매·용매 2

HCID 7187Benzoyl Peroxide촉매HCID 5943Carbon Tetrachloride용매

실험 절차

A solution of 18.8 grams (0.100 mole) of 2-ethyl-5-(4-methylphenyl)-1,2,3,4-tetraazole in 156 mL of carbon tetrachloride was stirred, and 19.6 grams (0.110 mole) of N-bromosuccinimide, followed by 0.24 gram (0.001 mole) of benzoyl peroxide were added. Upon completion of addition, the reaction mixture was heated to reflux where it stirred for 90 minutes. After this time the reaction mixture was cooled and filtered. The filtrate was concentrated under reduced pressure, yielding 27.7 grams of the subject compound. The NMR spectrum was consistent with the proposed structure.

후처리

  1. additionwere added
  2. additionUpon completion of addition
  3. temperaturethe reaction mixture was heated
  4. temperatureto reflux where it
  5. temperatureAfter this time the reaction mixture was cooled
  6. filtrationfiltered
  7. concentrationThe filtrate was concentrated under reduced pressure

출처 및 근거

ORD 기록
ord-feee1914c47f4592b66786ab9aa330c2
출처 데이터셋
uspto-grants-2010_03
특허 번호
US07683070B2

반응 노트

불러오는 중…