Water → 2-[(6,7-Dimethoxy-4-quinolyl)oxy]-5-iodobenzaldehyde

HRID 228563

반응식

HRID 228563 반응식
Cl[C:2]1[C:11]2[C:6](=[CH:7][C:8]([O:14][CH3:15])=[C:9]([O:12][CH3:13])[CH:10]=2)[N:5]=[CH:4][CH:3]=1.[I:16][C:17]1[CH:24]=[C:21]([CH:22]=[O:23])[C:20]([OH:25])=[CH:19][CH:18]=1.O>CN(C)C1C=CN=CC=1.ClC1C=CC=CC=1>[CH3:13][O:12][C:9]1[CH:10]=[C:11]2[C:6](=[CH:7][C:8]=1[O:14][CH3:15])[N:5]=[CH:4][CH:3]=[C:2]2[O:25][C:20]1[CH:19]=[CH:18][C:17]([I:16])=[CH:24][C:21]=1[CH:22]=[O:23]

참가 물질

6

반응물 3

HCID 962WaterHCID 2526125-IodosalicylaldehydeHCID 4596104-Chloro-6,7-dimethoxyquinoline

생성물 1

HCID 230784192-[(6,7-Dimethoxy-4-quinolyl)oxy]-5-iodobenzaldehyde

시약·촉매·용매 2

HCID 142844-(Dimethylamino)pyridine촉매HCID 7964Chlorobenzene용매

반응 조건

온도
130 °C

실험 절차

4-Chloro-6,7-dimethoxyquinoline (111 mg), 5-iodosalicylaldehyde (496 mg), and 4-dimethylaminopyridine (244 mg) were suspended in monochlorobenzene (2 ml), and the mixture was stirred at 130° C. overnight. The reaction solution was cooled to room temperature, water was then added to the reaction solution, and the mixture was extracted with ethyl acetate. The ethyl acetate layer was then washed with water and saturated brine and was dried over anhydrous sodium sulfate. The solvent was removed therefrom by distillation under the reduced pressure, and the residue was purified by chromatography on silica gel using ethyl acetate-hexane for development to give 2-[(6,7-dimethoxy-4-quinolyl)oxy]-5-iodobenzaldehyde.

후처리

  1. temperatureThe reaction solution was cooled to room temperature
  2. extractionthe mixture was extracted with ethyl acetate
  3. washThe ethyl acetate layer was then washed with water and saturated brine
  4. dry with materialwas dried over anhydrous sodium sulfate
  5. customThe solvent was removed
  6. distillationby distillation under the reduced pressure
  7. customthe residue was purified by chromatography on silica gel

출처 및 근거

ORD 기록
ord-d13683691b384adc9f5c74e52ac7528f
출처 데이터셋
uspto-grants-2009_07
특허 번호
US07560558B2

연결된 노트

불러오는 중…