Water → 6,7-Dimethoxy-4-(quinolin-3-yloxy)-quinoline

HRID 228832

반응식

HRID 228832 반응식
Cl[C:2]1[C:11]2[C:6](=[CH:7][C:8]([O:14][CH3:15])=[C:9]([O:12][CH3:13])[CH:10]=2)[N:5]=[CH:4][CH:3]=1.[OH:16][C:17]1[CH:18]=[N:19][C:20]2[C:25]([CH:26]=1)=[CH:24][CH:23]=[CH:22][CH:21]=2.O>CN(C)C1C=CN=CC=1.ClC1C=CC=CC=1Cl>[CH3:13][O:12][C:9]1[CH:10]=[C:11]2[C:6](=[CH:7][C:8]=1[O:14][CH3:15])[N:5]=[CH:4][CH:3]=[C:2]2[O:16][C:17]1[CH:18]=[N:19][C:20]2[C:25]([CH:26]=1)=[CH:24][CH:23]=[CH:22][CH:21]=2

참가 물질

6

반응물 3

HCID 962WaterHCID 113763-HydroxyquinolineHCID 4596104-Chloro-6,7-dimethoxyquinoline

생성물 1

HCID 230786096,7-Dimethoxy-4-(quinolin-3-yloxy)-quinoline수율 93%

시약·촉매·용매 2

HCID 142844-(Dimethylamino)pyridine촉매HCID 72391,2-Dichlorobenzene용매

반응 조건

온도
140 °C

실험 절차

4-Chloro-6,7-dimethoxyquinoline (243 mg), 3-hydroxyquinoline (100 mg), and 4-dimethylaminopyridine (348 mg) were dissolved in o-dichlorobenzene (13 ml) to prepare a solution which was stirred at 140° C. overnight. The reaction solution was cooled to room temperature, water was then added to the reaction solution, and the mixture was extracted with ethyl acetate. The ethyl acetate layer was then washed with water and was dried over anhydrous sodium sulfate, the solvent was removed by distillation under the reduced pressure, and the residue was purified by thin layer chromatography using acetone-chloroform to give the title compound (213 mg, yield 93%).

후처리

  1. customto prepare a solution which
  2. temperatureThe reaction solution was cooled to room temperature
  3. extractionthe mixture was extracted with ethyl acetate
  4. washThe ethyl acetate layer was then washed with water
  5. dry with materialwas dried over anhydrous sodium sulfate
  6. customthe solvent was removed by distillation under the reduced pressure
  7. customthe residue was purified by thin layer chromatography

출처 및 근거

ORD 기록
ord-1ceeb59e2a95490fbfa9d494e912e729
출처 데이터셋
uspto-grants-2009_07
특허 번호
US07560558B2

연결된 노트

불러오는 중…