Tetrahydrofuran → 3-Allyloxy-4-methoxystyrene

HRID 235611노트

반응식

HRID 235611 반응식
[NH2-].[Na+].[CH2:3]([O:6][C:7]1[CH:8]=[C:9]([CH:12]=[CH:13][C:14]=1[O:15][CH3:16])[CH:10]=O)[CH:4]=[CH2:5].O1CCC[CH2:18]1>[Br-].C[P+](C1C=CC=CC=1)(C1C=CC=CC=1)C1C=CC=CC=1>[CH2:3]([O:6][C:7]1[CH:8]=[C:9]([CH:12]=[CH:13][C:14]=1[O:15][CH3:16])[CH:10]=[CH2:18])[CH:4]=[CH2:5]

참가 물질

5

반응물 3

HCID 8028TetrahydrofuranHCID 24533Sodium amideHCID 5341483-Allyloxy-4-methoxybenzaldehyde

생성물 1

HCID 198314233-Allyloxy-4-methoxystyrene

시약·촉매·용매 1

HCID 74505Methyltriphenyliphosphonium bromide촉매

실험 절차

Sodium amide (39 g) was dispersed in dry tetrahydrofuran (800 mls). Methyltriphenylphosphonium bromide (102 g) was added and the mixture stirred at R.T. for 2 hours. 3-allyloxy-4-methoxy-benzaldehyde (50 g) was then added dropwise over ca. 15 mins. and the mixture stirred for a further 3 hours. The mixture was filtered and the solvent removed from the filtrate under reduced pressure. The residue was washed with diethyl ether (1.51) and the solvent removed to yield a brown coloured resin. The washing process was repeated and the residue obtained was distilled under reduced pressure to give 3-allyloxy-4-methoxystyrene (29.5 g), b.p. 98°-104° C. at 0.8 mbar.

후처리

  1. stirringand the mixture stirred for a further 3 hours
  2. filtrationThe mixture was filtered
  3. customthe solvent removed from the filtrate under reduced pressure
  4. washThe residue was washed with diethyl ether (1.51)
  5. customthe solvent removed
  6. customto yield a brown coloured resin
  7. customthe residue obtained
  8. distillationwas distilled under reduced pressure

출처 및 근거

ORD 기록
ord-26d2155a0ac94079a164b7eb4823f55f
출처 데이터셋
uspto-grants-1987_02
특허 번호
US04640849

반응 노트

불러오는 중…