Potassium Carbonate → 4',4-Dichlorochalcone

HRID 2379305

반응식

HRID 2379305 반응식
C(=O)([O-])[O-].[K+].[K+].[Cl:7][C:8]1[CH:13]=[CH:12][C:11]([CH2:14]S(F)(=O)=O)=[CH:10][CH:9]=1.[Cl:19][C:20]1[CH:29]=[CH:28][C:23]([C:24](=[O:27])[CH2:25]Br)=[CH:22][CH:21]=1>[Br-].C([N+](CCCC)(CCCC)CCCC)CCC.O1CCCC1>[Cl:19][C:20]1[CH:29]=[CH:28][C:23]([C:24](=[O:27])/[CH:25]=[CH:14]/[C:11]2[CH:12]=[CH:13][C:8]([Cl:7])=[CH:9][CH:10]=2)=[CH:22][CH:21]=1

참가 물질

6

반응물 3

HCID 11430Potassium CarbonateHCID 68303p-Chlorophenacyl bromideHCID 18958404HCID 18958404, 화합물

생성물 1

HCID 53770114',4-Dichlorochalcone수율 68.7%

시약·촉매·용매 2

HCID 74236Tetrabutylammonium Bromide촉매HCID 8028Tetrahydrofuran용매

실험 절차

A catalytic amount (about 300 mg) of tetrabutylammonium bromide and 68 g of powdered anydrous potassium carbonate were added to a solution of 21.8 g 4-chlorophenylmethanesulphonyl fluoride and 23.3 g of 4-chlorophenacyl bromide in 200 ml of tetrahydrofuran at room temperature, while stirring. The mixture was stirred for a further 8 hours at 50° C. The reaction mixture was allowed to cool down to room temperature and was then filtered to remove inorganic substances which had precipitated. The organic phase was concentrated by stripping off the solvent under reduced pressure. The residue was recrystallized from ethanol. In this manner, 19.0 g of trans-1,3-di-(4-chlorophenyl)-prop-2-en-1-one were obtained in the form of yellow crystals of melting point 156° C.

후처리

  1. stirringThe mixture was stirred for a further 8 hours at 50° C
  2. filtrationwas then filtered
  3. customto remove inorganic substances which
  4. customhad precipitated
  5. concentrationThe organic phase was concentrated
  6. customThe residue was recrystallized from ethanol

출처 및 근거

ORD 기록
ord-8d838e072ffe4b74bc4706278c196e33
출처 데이터셋
uspto-grants-1994_11
특허 번호
US05360935

연결된 노트

불러오는 중…