Maleic Anhydride → Furan-2,5-dione;5-methylidenebicyclo[2.2.1]hept-2-ene

HRID 23858

반응식

HRID 23858 반응식
[C:1]1(=[O:7])[O:6][C:4](=[O:5])[CH:3]=[CH:2]1.O1[CH2:12][CH2:11][CH2:10][CH2:9]1>N(C(C)(C)C#N)=NC(C)(C)C#N.CCCCCC>[CH2:1]=[C:2]1[CH2:12][CH:11]2[CH2:4][CH:3]1[CH:9]=[CH:10]2.[C:4]1(=[O:5])[O:6][C:1](=[O:7])[CH:2]=[CH:3]1

참가 물질

5

반응물 2

HCID 7923Maleic AnhydrideHCID 8028Tetrahydrofuran

생성물 1

HCID 287853Furan-2,5-dione;5-methylidenebicyclo[2.2.1]hept-2-ene수율 183.7%

시약·촉매·용매 2

HCID 6547Azobisisobutyronitrile촉매HCID 8058Hexane용매

실험 절차

This synthesis example is directed to the synthesis of polymer (1b) (illustrated below as chemical formulas 14 or 15), a γ-hydroxy carboxylic acid structure. 21.2 g of 5-ethylenebicyclo[2.2.1]hept-2-ene, 19.6 g of maleic anhydride, 2.56 g of 2,2′-azobisisobutyronitrile, and 240 g of tetrahydrofuran were placed in a 500-ml, three-necked flask equipped with a thermometer, a condenser pipe, and a nitrogen inlet pipe, and the mixture was heated under reflux at 70C while introducing nitrogen for 8 hr to conduct polymerization. After the completion of the polymerization, the reaction mixture was poured into 1000 ml of n-hexane to precipitate the resultant polymer, which was then dried to give 37.5 g of a 5-methylenebicyclo[2.2.1]hept-2-ene/maleic anhydride copolymer (1a) (yield 92%). The polymer was analyzed by various methods and was found to mainly have a structure represented by the following formula:

후처리

  1. customequipped with a thermometer, a condenser pipe, and a nitrogen inlet pipe
  2. temperaturethe mixture was heated
  3. additionwhile introducing nitrogen for 8 hr
  4. custompolymerization
  5. customAfter the completion of the polymerization
  6. customto precipitate the resultant polymer, which
  7. customwas then dried

출처 및 근거

ORD 기록
ord-798ec26d93734613be60fae168b8210e
출처 데이터셋
uspto-grants-2005_02
특허 번호
US06855483B2

연결된 노트

불러오는 중…