Potassium Carbonate → tert-Butyl 2-((4-methylpiperazin-1-yl)methyl)-6,7-dihydrothieno[3,2-c]pyridine-5(4H)-carboxylate

HRID 2388727노트

반응식

HRID 2388727 반응식
C(=O)([O-])[O-].[K+].[K+].[CH3:7][N:8]1[CH2:13][CH2:12][NH:11][CH2:10][CH2:9]1.CS(O[CH2:19][C:20]1[S:28][C:27]2[CH2:26][CH2:25][N:24]([C:29]([O:31][C:32]([CH3:35])([CH3:34])[CH3:33])=[O:30])[CH2:23][C:22]=2[CH:21]=1)(=O)=O>C1(C)C=CC=CC=1.C(OCC)(=O)C>[CH3:7][N:8]1[CH2:13][CH2:12][N:11]([CH2:19][C:20]2[S:28][C:27]3[CH2:26][CH2:25][N:24]([C:29]([O:31][C:32]([CH3:35])([CH3:34])[CH3:33])=[O:30])[CH2:23][C:22]=3[CH:21]=2)[CH2:10][CH2:9]1

참가 물질

6

반응물 3

HCID 11430Potassium CarbonateHCID 531671-MethylpiperazineHCID 86635666tert-Butyl 2-((methylsulfonyloxy)methyl)-6,7-dihydrothieno[3,2-c]pyridine-5(4H)-carboxylate

생성물 1

HCID 57948670tert-Butyl 2-((4-methylpiperazin-1-yl)methyl)-6,7-dihydrothieno[3,2-c]pyridine-5(4H)-carboxylate수율 50%

시약·촉매·용매 2

HCID 1140Toluene용매HCID 8857Ethyl Acetate용매

실험 절차

Potassium carbonate (26.5 mmol) and N-methylpiperazine (6.36 mmol) was added to a solution of tert-butyl 2-((methylsulfonyloxy)methyl)-6,7-dihydrothieno-[3,2-c]pyridine-5(4H)-carboxylate (5.3 mmol) in toluene (30 ml). The reaction mixture obtained was heated under reflux for 16 hours. The reaction temperature was then reduced to 25° C. and the reaction mixture was diluted with ethyl acetate. The reaction mixture was washed with water and saturated sodium chloride solution and dried over sodium sulfate. After the solvent had been removed under reduced pressure, the crude product obtained was purified by column chromatography (5% methanol in methylene chloride). The desired product was obtained in a yield of 50%.

후처리

  1. customThe reaction mixture obtained
  2. temperaturewas heated
  3. temperatureunder reflux for 16 hours
  4. customwas then reduced to 25° C.
  5. washThe reaction mixture was washed with water and saturated sodium chloride solution
  6. dry with materialdried over sodium sulfate
  7. customAfter the solvent had been removed under reduced pressure
  8. customthe crude product obtained
  9. customwas purified by column chromatography (5% methanol in methylene chloride)

출처 및 근거

ORD 기록
ord-619a8effcbe44fa4be59cf0a8d0519c1
출처 데이터셋
uspto-grants-2012_09
특허 번호
US08268814B2

반응 노트

불러오는 중…