Acetonitrile → 2-Pentylidenecyclopentanone

HRID 2413370노트

반응식

HRID 2413370 반응식
[CH2:1]([C:6]1(C(OCC=C)=O)[CH2:10][CH2:9][CH2:8][C:7]1=[O:11])[CH2:2][CH2:3][CH2:4][CH3:5].C(#N)C>C([O-])(=O)C.[Pd+2].C([O-])(=O)C>[CH2:1]([C:6]1[C:7](=[O:11])[CH2:8][CH2:9][CH:10]=1)[CH2:2][CH2:3][CH2:4][CH3:5].[CH:1](=[C:6]1[CH2:10][CH2:9][CH2:8][C:7]1=[O:11])[CH2:2][CH2:3][CH2:4][CH3:5]

참가 물질

5

반응물 2

HCID 6342AcetonitrileHCID 13005779Prop-2-en-1-yl 2-oxo-1-pentylcyclopentane-1-carboxylate

생성물 2

HCID 860002-PentylidenecyclopentanoneHCID 1175492-Cyclopenten-1-one, 2-pentyl-

시약·촉매·용매 1

HCID 167845palladium(II) acetate촉매

실험 절차

A vessel was charged with 1 mole of allyl 1-pentyl-2-oxocyclopentanecarboxylate of the following formula ##STR7## 20 moles of acetonitrile, 0.05 mole of palladium acetate and 0.05 mole of α,β-ethylenedi(diphenyl)phosphine, and after these materials were rapidly stirred at room temperature, they were heated to the boiling point of the solvent and reacted under reflux for 30 minutes. After the reaction, the reaction mixture was distilled under reduced pressure in a customary manner to give 2-pentyl-2-cyclopenten-1-one and 2-pentylidenecyclopentanone in a yield of 65% and 13%, respectively. These compounds were identified by using IR, NMR and mass spectroscopic techniques.

후처리

  1. temperaturethey were heated to the boiling point of the solvent
  2. customreacted
  3. temperatureunder reflux for 30 minutes
  4. customAfter the reaction
  5. distillationthe reaction mixture was distilled under reduced pressure in a customary manner

출처 및 근거

ORD 기록
ord-b9569292ecad4adab38cf33cd131a0a1
출처 데이터셋
uspto-grants-1985_01
특허 번호
US04496766

반응 노트

불러오는 중…