Quinoline-3-carboxylic acid → 5,6,7,8-Tetrahydroquinoline-3-carboxylic acid

HRID 324518

반응식

HRID 324518 반응식
[N:1]1[C:10]2[C:5](=[CH:6][CH:7]=[CH:8][CH:9]=2)[CH:4]=[C:3]([C:11]([OH:13])=[O:12])[CH:2]=1>FC(F)(F)C(O)=O.[Pt](=O)=O>[N:1]1[C:10]2[CH2:9][CH2:8][CH2:7][CH2:6][C:5]=2[CH:4]=[C:3]([C:11]([OH:13])=[O:12])[CH:2]=1

참가 물질

4

반응물 1

HCID 80971Quinoline-3-carboxylic acid

생성물 1

HCID 217959145,6,7,8-Tetrahydroquinoline-3-carboxylic acid수율 43.5%

시약·촉매·용매 2

HCID 345198Adams' catalyst촉매HCID 6422Trifluoroacetic acid용매

실험 절차

A mixture of 3-quinolinecarboxylic acid (1.73 g, 10.0 mmol) in trifluoroacetic acid (20 ml) with platinum dioxide (200 mg) was shaken in a Parr vessel at 10-15 psi. After 90 minutes the reaction mixture was filtered and the solvent removed in vacuo to yield an oil. The oil was added dropwise onto diethyl ether yielding a white solid which was collected by filtration and then recrystallised from ethyl acetate/hexane to yield the title compound as a white solid (770 mg).

후처리

  1. filtrationAfter 90 minutes the reaction mixture was filtered
  2. customthe solvent removed in vacuo
  3. customto yield an oil
  4. additionThe oil was added dropwise onto diethyl ether yielding a white solid which
  5. filtrationwas collected by filtration
  6. customrecrystallised from ethyl acetate/hexane

출처 및 근거

ORD 기록
ord-292f9472f52d442095ef52e79c8a4349
출처 데이터셋
uspto-grants-2001_04
특허 번호
US06218393B1

연결된 노트

불러오는 중…