N-bromobutanimide → 2-Bromomethyl-7-nitrobenzo[b]furan

HRID 342415

반응식

HRID 342415 반응식
[CH3:1][C:2]1[O:6][C:5]2[C:7]([N+:11]([O-:13])=[O:12])=[CH:8][CH:9]=[CH:10][C:4]=2[CH:3]=1.[Br:14]N1C(=O)CCC1=O>ClCCl.N(C(C)(CC(C)(OC)C)C#N)=NC(C)(CC(OC)(C)C)C#N>[Br:14][CH2:1][C:2]1[O:6][C:5]2[C:7]([N+:11]([O-:13])=[O:12])=[CH:8][CH:9]=[CH:10][C:4]=2[CH:3]=1

참가 물질

5

반응물 2

HCID 67184N-bromobutanimideHCID 132018972-Methyl-7-nitrobenzofuran

생성물 1

HCID 702014072-Bromomethyl-7-nitrobenzo[b]furan수율 85.8%

시약·촉매·용매 2

HCID 858672,2'-Azobis(2,4-dimethyl-4-methoxyvaleronitrile)촉매HCID 6344Dichloromethane용매

실험 절차

A mixture of 2-methyl-7-nitrobenzo[b]furan (2.66 g), N-bromosuccinimide (3.21 g) and 2,2'-azobis-(2,4-dimethyl-4-methoxyvaleronitrile) (270 mg) in dichloromethane (30 ml) was refluxed for 1 hour. The reaction mixture was washed with aqueous saturated sodium bicarbonate and brine, dried over sodium sulfate and concentrated in vacuo. The residue was crystallized from diethyl ether to give 2-bromomethyl-7-nitrobenzo[b]furan (3.3 g).

후처리

  1. temperaturewas refluxed for 1 hour
  2. washThe reaction mixture was washed with aqueous saturated sodium bicarbonate and brine
  3. dry with materialdried over sodium sulfate
  4. concentrationconcentrated in vacuo
  5. customThe residue was crystallized from diethyl ether

출처 및 근거

ORD 기록
ord-2f69eb1bd2b8421aa4906d6bbc2b956e
출처 데이터셋
uspto-grants-1999_01
특허 번호
US05858995

연결된 노트

불러오는 중…