Morpholine → Ethyl 2,6-dimethyl-3-(propan-2-yl)benzoate

HRID 354544

반응식

HRID 354544 반응식
N1CCOC[CH2:2]1.[CH:7](=O)[CH2:8][CH:9](C)C.S([O-])([O-])(=O)=O.[Mg+2].[CH3:19][C:20]1[C:25]([C:26]([O:28][CH2:29][CH3:30])=[O:27])=[C:24]([CH3:31])O[C:22](=O)[CH:21]=1>C1(C)C=CC(S(O)(=O)=O)=CC=1.C1(C)C=CC=CC=1>[CH3:19][C:20]1[C:21]([CH:8]([CH3:9])[CH3:7])=[CH:22][CH:2]=[C:24]([CH3:31])[C:25]=1[C:26]([O:28][CH2:29][CH3:30])=[O:27]

참가 물질

7

반응물 4

HCID 8083MorpholineHCID 115523-MethylbutanalHCID 24083Sulfuric acid magnesium salt (1:1)HCID 76918ethyl 4,6-dimethyl-2-oxo-2H-pyran-5-carboxylate

생성물 1

HCID 13126300Ethyl 2,6-dimethyl-3-(propan-2-yl)benzoate수율 8.3%

시약·촉매·용매 2

HCID 6101p-Toluenesulfonic acid촉매HCID 1140Toluene용매

실험 절차

Morpholine (13.34 g), isovaleraldehyde (13.18 g), p-toluenesulfonic acid (0.2 g), and toluene (300 ml) were combined and heated at reflux using a Soxhlet extractor with magnesium sulfate to remove any water produced. After three hours the Soxhlet extractor was replaced with a condenser, and ethyl 4,6-dimethyl-2-oxo-2H-pyran-5-carboxylate (30 g) was added. The reaction mixture was heated under reflux for approximately 64 hours. The solvent was evaporated, and the resultant oil was distilled to give 11.1 g of crude product which was chromatographed to yield ethyl 2,6-dimethyl-3-(1-methylethyl)benzoate (2.8 g).

후처리

  1. temperatureheated
  2. temperatureat reflux
  3. customto remove any water
  4. customproduced
  5. temperatureThe reaction mixture was heated
  6. temperatureunder reflux for approximately 64 hours
  7. customThe solvent was evaporated
  8. distillationthe resultant oil was distilled
  9. customto give 11.1 g of crude product which
  10. customwas chromatographed

출처 및 근거

ORD 기록
ord-3deaa738e08b489ea56184426ebd4810
출처 데이터셋
uspto-grants-1983_03
특허 번호
US04375476

연결된 노트

불러오는 중…