Chlorine → 1-Chloro-2-(difluoromethoxy)benzene

HRID 375287

반응식

HRID 375287 반응식
[F:1][CH:2]([F:10])[O:3][C:4]1[CH:9]=[CH:8][CH:7]=[CH:6][CH:5]=1.[Cl:11]Cl>FC(F)(F)C1C=CC=C(C(F)(F)F)C=1.[Cl-].[K+]>[Cl:11][C:5]1[CH:6]=[CH:7][CH:8]=[CH:9][C:4]=1[O:3][CH:2]([F:10])[F:1]

참가 물질

5

반응물 2

HCID 24526Chlorine2회HCID 68015(Difluoromethoxy)benzene2회

생성물 1

HCID 134050971-Chloro-2-(difluoromethoxy)benzene

시약·촉매·용매 2

HCID 4873Potassium Chloride촉매HCID 223106Benzene, 1,3-bis(trifluoromethyl)-용매

실험 절차

0.5 g of potassium chloride and 10 g of difluoromethoxybenzene in 100 ml of 1,3-bistrifluoromethylbenzene were introduced as the initial charge, and chlorine was then introduced at 100° C. with UV irradiation. In the course of an hour, another 20 g of difluoromethoxybenzene were metered in. After chlorine uptake was complete, the reaction mixture was purged with nitrogen and subsequently distilled. 35.5 g of chlorodifluoromethoxybenzene were isolated (boiling point 144° C., refractive index nD20 1.4479).

후처리

  1. additioninitial charge
  2. customIn the course of an hour
  3. customthe reaction mixture was purged with nitrogen
  4. distillationsubsequently distilled

출처 및 근거

ORD 기록
ord-ce9e40feb79b4bcab347a1604d5df2cc
출처 데이터셋
uspto-grants-1996_01
특허 번호
US05484932

연결된 노트

불러오는 중…