Urea → 4-(3,5-Bis-trifluoromethylphenyl)-6-methyl-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylic acid amide

HRID 393683

반응식

HRID 393683 반응식
[F:1][C:2]([F:16])([F:15])[C:3]1[CH:4]=[C:5]([CH:8]=[C:9]([C:11]([F:14])([F:13])[F:12])[CH:10]=1)[CH:6]=O.[C:17]([NH2:23])(=[O:22])[CH2:18][C:19]([CH3:21])=O.[NH2:24][C:25]([NH2:27])=[O:26].B(F)(F)F.CCOCC>[Cu](Cl)Cl.C1COCC1.CC(O)=O>[F:1][C:2]([F:16])([F:15])[C:3]1[CH:4]=[C:5]([CH:6]2[C:18]([C:17]([NH2:23])=[O:22])=[C:19]([CH3:21])[NH:27][C:25](=[O:26])[NH:24]2)[CH:8]=[C:9]([C:11]([F:14])([F:13])[F:12])[CH:10]=1

참가 물질

8

반응물 4

HCID 1176UreaHCID 8000Boron trifluoride etherateHCID 80077AcetoacetamideHCID 1362473,5-Bis(trifluoromethyl)benzaldehyde

생성물 1

HCID 865860054-(3,5-Bis-trifluoromethylphenyl)-6-methyl-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylic acid amide수율 36.2%

시약·촉매·용매 3

HCID 24014Cupric Chloride촉매HCID 176Acetic Acid용매HCID 8028Tetrahydrofuran용매

반응 조건

온도
65 °C

실험 절차

A mixture of 3,5-bis(trifluoromethyl)benzaldehyde (2.42 g, 10.0 mmol), acetoacetamide (1.01 g, 10.0 mmol), urea (0.90 g, 15.0 mmol), copper chloride (0.1 g, 1.0 mmol), boron trifluoride etherate (0.09 mL), AcOH (0.04 mL), and THF (20 mL) was heated at 65° C. for 18 h and cooled to room temperature. The resulting precipitates were collected by vacuum filtration, washed with THF, and air dried to give the title compound as an off-white solid(1.33 g, 36%).

후처리

  1. temperaturecooled to room temperature
  2. customThe resulting precipitates
  3. filtrationwere collected by vacuum filtration
  4. washwashed with THF, and air
  5. customdried

출처 및 근거

ORD 기록
ord-b6dad4d14dd3474a9e23c7ce406e1919
출처 데이터셋
uspto-grants-2004_10
특허 번호
US06809102B2

연결된 노트

불러오는 중…