Methanesulfonyl chloride → 4-Benzyloxy-3-methyl-phenyl-2-methoxy-acrylic acid ethyl ester

HRID 459180노트

반응식

HRID 459180 반응식
[CH2:1]([O:3][C:4](=[O:25])[CH:5]([O:23][CH3:24])[CH:6]([C:8]1[CH:13]=[CH:12][C:11]([O:14][CH2:15][C:16]2[CH:21]=[CH:20][CH:19]=[CH:18][CH:17]=2)=[C:10]([CH3:22])[CH:9]=1)O)[CH3:2].S(Cl)(C)(=O)=O>CN(C1C=CN=CC=1)C.ClCCl.CCOCC>[CH2:1]([O:3][C:4](=[O:25])[C:5]([O:23][CH3:24])=[CH:6][C:8]1[CH:13]=[CH:12][C:11]([O:14][CH2:15][C:16]2[CH:17]=[CH:18][CH:19]=[CH:20][CH:21]=2)=[C:10]([CH3:22])[CH:9]=1)[CH3:2]

참가 물질

6

반응물 2

HCID 31297Methanesulfonyl chlorideHCID 694224223-(4-Benzyloxy-3-methyl-phenyl)-3-hydroxy-2-methoxy-propionic acid ethyl ester

생성물 1

HCID 694952094-Benzyloxy-3-methyl-phenyl-2-methoxy-acrylic acid ethyl ester

시약·촉매·용매 3

HCID 142844-(Dimethylamino)pyridine촉매HCID 3283Diethyl Ether용매HCID 6344Dichloromethane용매

실험 절차

A mixture of 3-(4-Benzyloxy-3-methyl-phenyl)-3-hydroxy-2-methoxy-propionic acid ethyl ester (1 eq), Mesylchloride (1 eq) triethylamine (4 eq) and a catalytic amount of DMAP (0.1 eq) in dichloromethane was stirred at room temperature over night. The reaction mixture was diluted with ether and washed with HCl 1N. Dried and concentrated in vacuo to give a residue which was chromatographed in silica gel to yield the title compound.

후처리

  1. washwashed with HCl 1N
  2. customDried
  3. concentrationconcentrated in vacuo
  4. customto give a residue which
  5. customwas chromatographed in silica gel

출처 및 근거

ORD 기록
ord-87afeabfc67d4f01aa96f5e6621454f6
출처 데이터셋
uspto-grants-2007_03
특허 번호
US07192982B2

반응 노트

불러오는 중…