Acetonitrile → 2-(2-Pentynyl)-2-cyclopenten-1-one

HRID 482786노트

반응식

HRID 482786 반응식
[CH2:1]([C:6]1(C(OCC=C)=O)[CH2:10][CH2:9][CH2:8][C:7]1=[O:11])[C:2]#[C:3][CH2:4][CH3:5].C(#N)C>C([O-])(=O)C.[Pd+2].C([O-])(=O)C>[CH2:1]([C:6]1[C:7](=[O:11])[CH2:8][CH2:9][CH:10]=1)[C:2]#[C:3][CH2:4][CH3:5]

참가 물질

4

반응물 2

HCID 6342AcetonitrileHCID 10868228Cyclopentanecarboxylic acid, 2-oxo-1-(2-pentynyl)-, 2-propenyl ester

생성물 1

HCID 110080722-(2-Pentynyl)-2-cyclopenten-1-one수율 85%

시약·촉매·용매 1

HCID 167845palladium(II) acetate촉매

실험 절차

A vessel was charged with 1 mole of allyl 1-(2-pentynyl)-2-oxocyclopentanecarboxylate of the following formula ##STR5## 20 moles of acetonitrile and 0.01 mole of palladium acetate. At room temperature, they were rapidly stirred. The mixture was then heated to the boiling point of the solvent, and the reaction was carried out under reflux for 30 minutes. After the reaction, the reaction mixture was distilled under reduced pressure in a customary manner to give 2-(2-pentynyl)-2-cyclopenten-1-one (PCP for short) in a yield of 85%. This compound was identified by using its IR, NMR and mass spectra.

후처리

  1. temperatureThe mixture was then heated to the boiling point of the solvent
  2. temperatureunder reflux for 30 minutes
  3. customAfter the reaction
  4. distillationthe reaction mixture was distilled under reduced pressure in a customary manner

출처 및 근거

ORD 기록
ord-37b3470a4d4f47938b25d97c9d4d8c96
출처 데이터셋
uspto-grants-1986_03
특허 번호
US04575570

반응 노트

불러오는 중…