Trifluoroacetic acid → 1-(Benzo[d][1,3]dioxol-5-yl)-N-(2-tert-butyl-1-(1,3-dihydroxypropan-2-yl)indolin-5-yl)cyclopropanecarboxamide

HRID 503459

반응식

HRID 503459 반응식
[O:1]1[C:5]2[CH:6]=[CH:7][C:8]([C:10]3([C:13]([NH:15][C:16]4[CH:17]=[C:18]5[C:22](=[CH:23][CH:24]=4)[NH:21][CH:20]([C:25]([CH3:28])([CH3:27])[CH3:26])[CH2:19]5)=[O:14])[CH2:12][CH2:11]3)=[CH:9][C:4]=2[O:3][CH2:2]1.F[C:30](F)(F)[C:31]([OH:33])=O.[C:36](O[BH-](OC(=O)C)OC(=O)C)(=[O:38])C.[Na+]>ClC(Cl)C.CC1(C)OCC(=O)CO1>[O:1]1[C:5]2[CH:6]=[CH:7][C:8]([C:10]3([C:13]([NH:15][C:16]4[CH:17]=[C:18]5[C:22](=[CH:23][CH:24]=4)[N:21]([CH:30]([CH2:31][OH:33])[CH2:36][OH:38])[CH:20]([C:25]([CH3:28])([CH3:27])[CH3:26])[CH2:19]5)=[O:14])[CH2:12][CH2:11]3)=[CH:9][C:4]=2[O:3][CH2:2]1

참가 물질

6

반응물 3

HCID 6422Trifluoroacetic acidHCID 5049666Sodium triacetoxyborohydrideHCID 591292381-(Benzo[d][1,3]dioxol-5-yl)-N-(2-tert-butylindolin-5-yl)cyclopropanecarboxamide

생성물 1

HCID 591294261-(Benzo[d][1,3]dioxol-5-yl)-N-(2-tert-butyl-1-(1,3-dihydroxypropan-2-yl)indolin-5-yl)cyclopropanecarboxamide

시약·촉매·용매 2

HCID 63651,1-Dichloroethane용매HCID 27331412,2-Dimethyl-1,3-dioxan-5-one용매

실험 절차

1-(Benzo[d][1,3]dioxol-5-yl)-N-(2-tert-butylindolin-5-yl)cyclopropanecarboxamide (50 mg, 0.13 mmol) was dissolved in dichloroethane (0.20 mL) and 2,2-dimethyl-1,3-dioxan-5-one (0.20 mL). Trifluoroacetic acid was added (0.039 mL) and the resulting solution was allowed to stir for 20 minutes. Sodium triacetoxyborohydride was added (55 mg, 0.26 mmol) and the reaction mixture was stirred for 30 minutes. The crude reaction mixture was then evaporated to dryness, dissolved in N,N-dimethylformamide and purified by preparative HPLC using a gradient of 0-99% acetonitrile in water containing 0.05% trifluoroacetic acid.

후처리

  1. stirringthe reaction mixture was stirred for 30 minutes
  2. customThe crude reaction mixture
  3. customwas then evaporated to dryness
  4. dissolutiondissolved in N,N-dimethylformamide
  5. custompurified by preparative HPLC

출처 및 근거

ORD 기록
ord-7fe719fd5c904bfb8b7c73da52b97d18
출처 데이터셋
uspto-grants-2010_08
특허 번호
US07776905B2

연결된 노트

불러오는 중…