Benzenesulfonyl chloride → 2,4-Dimethyldiphenylsulfone

HRID 505982

반응식

HRID 505982 반응식
CCCCN1C=[N+](C)C=C1.[C:11]1([CH3:18])[CH:16]=[CH:15][CH:14]=[C:13]([CH3:17])[CH:12]=1.[C:19]1([S:25](Cl)(=[O:27])=[O:26])[CH:24]=[CH:23][CH:22]=[CH:21][CH:20]=1>N(S(C(F)(F)F)(=O)=O)S(C(F)(F)F)(=O)=O.N(S(C(F)(F)F)(=O)=O)S(C(F)(F)F)(=O)=O.[Zn+2]>[CH3:18][C:11]1[CH:16]=[CH:15][C:14]([S:25]([C:19]2[CH:24]=[CH:23][CH:22]=[CH:21][CH:20]=2)(=[O:27])=[O:26])=[C:13]([CH3:17])[CH:12]=1

참가 물질

5

반응물 3

HCID 7369Benzenesulfonyl chloride2회HCID 7929M-XyleneHCID 27341621-Butyl-3-methylimidazolium

생성물 1

HCID 5210842,4-Dimethyldiphenylsulfone수율 99%

시약·촉매·용매 1

HCID 131725279Zinc(II) bis-triflimide촉매

실험 절차

Zinc(II) bis-triflimide (0.062 g, 1 mol %) was dissolved in [bmim] [NTf2] (1.0 g) in a round-bottomed flask equipped with a magnetic stirrer and reflux condenser and m-xylene (2.12 g, 20 mmol) and benzene sulfonyl chloride (1.76 g, 10 mmol) were added. The mixture was heated under reflux for 18 hours and was analysed by gas chromatographic analysis as in previous examples. All the benzene sulfonyl chloride had reacted and mostly 2,4-dimethyldiphenylsulfone had formed (yield=99%, 20:1 isomer ratio {by NMR}). The major product is shown below, the structure of the minor isomer is not known but is believed to be the 2,6-dimethyl isomer.

후처리

  1. customequipped with a magnetic stirrer
  2. temperaturereflux condenser
  3. temperatureThe mixture was heated
  4. temperatureunder reflux for 18 hours

출처 및 근거

ORD 기록
ord-2dee0ecbec004775a240ba780a38d605
출처 데이터셋
uspto-grants-2010_08
특허 번호
US07781625B2

연결된 노트

불러오는 중…