Benzoyl chloride → 2-(2-Hydroxy-4-isopropylphenyl)-1,3-dioxo-2,3-dihydro-1H-inden-2-yl benzoate

HRID 527119

반응식

HRID 527119 반응식
[OH:1][C:2]1([C:13]2[CH:18]=[CH:17][C:16]([CH:19]([CH3:21])[CH3:20])=[CH:15][C:14]=2[OH:22])[C:10](=[O:11])[C:9]2[C:4](=[CH:5][CH:6]=[CH:7][CH:8]=2)[C:3]1=[O:12].[C:23](Cl)(=[O:30])[C:24]1[CH:29]=[CH:28][CH:27]=[CH:26][CH:25]=1.C(N(CC)CC)C>C(Cl)Cl.CC(NP(OC1C=CC(Cl)=CC=1Cl)(OC)=S)C>[C:23]([O:1][C:2]1([C:13]2[CH:18]=[CH:17][C:16]([CH:19]([CH3:20])[CH3:21])=[CH:15][C:14]=2[OH:22])[C:10](=[O:11])[C:9]2[C:4](=[CH:5][CH:6]=[CH:7][CH:8]=2)[C:3]1=[O:12])(=[O:30])[C:24]1[CH:29]=[CH:28][CH:27]=[CH:26][CH:25]=1

참가 물질

6

반응물 3

HCID 7412Benzoyl chlorideHCID 8471TriethylamineHCID 30544341H-Indene-1,3(2H)-dione, 2-hydroxy-2-(2-hydroxy-4-(1-methylethyl)phenyl)-

생성물 1

HCID 714766762-(2-Hydroxy-4-isopropylphenyl)-1,3-dioxo-2,3-dihydro-1H-inden-2-yl benzoate수율 60%

시약·촉매·용매 2

HCID 9299Zytron촉매HCID 6344Dichloromethane용매

실험 절차

2-hydroxy-2-(2-hydroxy-4-isopropyl-phenyl)-indan-1,3-dione (1.00 g, 3.37 mmol) was completely dissolved in anhydrous methylene chloride (20 ml). This solution was added with benzoyl chloride (0.94 g, 6.74 mmol), triethylamine (0.41 g, 4.04 mmol), and DMPA (0.01 g), followed by heating 24 hrs under reflux. After the reaction mixture was concentrated, extracted with dichloromethane, and the organic layer was concentrated and purified using column chromatography (ethylacetate:hexane=1:4) to afford the title compound (0.81 g, 14%).

후처리

  1. temperatureby heating 24 hrs
  2. temperatureunder reflux
  3. concentrationAfter the reaction mixture was concentrated
  4. extractionextracted with dichloromethane
  5. concentrationthe organic layer was concentrated
  6. custompurified

출처 및 근거

ORD 기록
ord-615bee9a0f734bd7bbb05fff6487ce3d
출처 데이터셋
uspto-grants-2016_05
특허 번호
US09346749B2

연결된 노트

불러오는 중…