Trimethoxysilane → HCID 89882370, 화합물

HRID 571120

반응식

HRID 571120 반응식
[Si:1]([N:8]([CH2:12][C:13]1[CH:18]=[CH:17][CH:16]=[CH:15][CH:14]=1)[CH2:9][CH:10]=[CH2:11])([C:4]([CH3:7])([CH3:6])[CH3:5])([CH3:3])[CH3:2].[CH3:19][O:20][SiH:21]([O:24][CH3:25])[O:22][CH3:23]>[Pt].C([Si](C)(C)O[Si](C=C)(C)C)=C.C1(C)C=CC=CC=1>[Si:1]([N:8]([CH2:12][C:13]1[CH:14]=[CH:15][CH:16]=[CH:17][CH:18]=1)[CH2:9][CH2:10][CH2:11][Si:21]([O:24][CH3:25])([O:22][CH3:23])[O:20][CH3:19])([C:4]([CH3:7])([CH3:5])[CH3:6])([CH3:3])[CH3:2]

참가 물질

5

반응물 2

HCID 17215TrimethoxysilaneHCID 89882110N-t-butyldimethylsilyl-N-benzyl-N-allylamine

생성물 1

HCID 89882370HCID 89882370, 화합물

시약·촉매·용매 2

HCID 10959889Platinum(0)-1,3-divinyl-1,1,3,3-tetramethyldisiloxane촉매HCID 1140Toluene용매

반응 조건

온도
50 °C

실험 절차

A flask equipped with a stirrer, reflux condenser, dropping funnel and thermometer was charged with 26.2 g (0.1 mol) of N-t-butyldimethylsilyl-N-benzyl-N-allylamine and 0.07 g of a toluene solution of platinum/1,3-divinyl-1,1,3,3-tetramethyldisiloxane complex (Pt concentration 3 wt %) and heated at 50° C. Once the internal temperature became steady, 12.2 g (0.1 mol) of trimethoxysilane was added dropwise over 1 hour. Stirring was continued at the temperature for a further 1 hour. The reaction solution was distilled, collecting 32.6 g of a fraction having a boiling point of 165-166° C./0.4 kPa.

후처리

  1. customA flask equipped with a stirrer
  2. temperaturereflux condenser
  3. distillationThe reaction solution was distilled
  4. customcollecting 32.6 g of a fraction

출처 및 근거

ORD 기록
ord-59b81b5c83dc40a4aecb7829f2768271
출처 데이터셋
uspto-grants-2015_05
특허 번호
US09024051B2

연결된 노트

불러오는 중…