Water → 4-Pentynoic acid, 1,1-dimethylethyl ester

HRID 597777

반응식

HRID 597777 반응식
C(=O)([O-])[O-].[K+].[K+].[C:7](Br)([CH3:10])([CH3:9])[CH3:8].[C:12]([OH:18])(=[O:17])[CH2:13][CH2:14][C:15]#[CH:16].O>[Cl-].C([N+](CC)(CC)CC)C1C=CC=CC=1.CN(C)C(=O)C>[C:12]([O:18][C:7]([CH3:10])([CH3:9])[CH3:8])(=[O:17])[CH2:13][CH2:14][C:15]#[CH:16]

참가 물질

7

반응물 4

HCID 962WaterHCID 10485t-Butyl bromideHCID 11430Potassium CarbonateHCID 224644-Pentynoic acid

생성물 1

HCID 108773414-Pentynoic acid, 1,1-dimethylethyl ester

시약·촉매·용매 2

HCID 66133Benzyl triethylammonium chloride촉매HCID 31374Dimethylacetamide용매

반응 조건

온도
55 °C

실험 절차

Benzyltriethylammonium chloride (5.92 g), potassium carbonate (93.4 g), and t-butyl bromide (143 ml) were added to a solution of 4-pentynoic acid (2550 mg) in N,N-dimethylacetamide (230 ml), and this reaction mixture was stirred at 55° C. for 24 hours. After water was added, the reaction mixture was extracted with ethyl acetate, washed with water, dried over anhydrous magnesium chloride, and then filtered through silica gel. The filtrate was concentrated under reduced pressure to give the title compound (2.10 g). This compound was used in the following reaction without further purification.

후처리

  1. extractionthe reaction mixture was extracted with ethyl acetate
  2. washwashed with water
  3. dry with materialdried over anhydrous magnesium chloride
  4. filtrationfiltered through silica gel
  5. concentrationThe filtrate was concentrated under reduced pressure

출처 및 근거

ORD 기록
ord-c8b59da672be474998bc6fc2c9998c2d
출처 데이터셋
uspto-grants-2011_03
특허 번호
US07897387B2

연결된 노트

불러오는 중…