Ethanol → Methyl 5'-fluoro-2'-nitrobiphenyl-2-carboxylate

HRID 627764

반응식

HRID 627764 반응식
[CH3:1][O:2][C:3]([C:5]1[CH:10]=[CH:9][CH:8]=[CH:7][C:6]=1B(O)O)=[O:4].Br[C:15]1[CH:20]=[C:19]([F:21])[CH:18]=[CH:17][C:16]=1[N+:22]([O-:24])=[O:23].C(O)C.C(=O)([O-])[O-].[Na+].[Na+]>ClCCl.C(O[Pd]OC(=O)C)(=O)C.C1(P(C2CCCCC2)C2C=CC=CC=2C2C(OC)=CC=CC=2OC)CCCCC1>[F:21][C:19]1[CH:18]=[CH:17][C:16]([N+:22]([O-:24])=[O:23])=[C:15]([C:6]2[C:5]([C:3]([O:2][CH3:1])=[O:4])=[CH:10][CH:9]=[CH:8][CH:7]=2)[CH:20]=1

참가 물질

8

반응물 4

HCID 702EthanolHCID 10340Sodium CarbonateHCID 27569932-Bromo-4-fluoro-1-nitrobenzeneHCID 27734962-(Methoxycarbonyl)benzeneboronic acid

생성물 1

HCID 67296936Methyl 5'-fluoro-2'-nitrobiphenyl-2-carboxylate수율 56.9%

시약·촉매·용매 3

HCID 167845palladium(II) acetate촉매HCID 112698722-Dicyclohexylphosphino-2',6'-dimethoxybiphenyl촉매HCID 6344Dichloromethane용매

실험 절차

To a microwave vessel was added 2-(methoxycarbonyl)phenylboronic acid (63.4 mg, 0.352 mmol), 2-bromo-4-fluoro-1-nitrobenzene (77 mg, 0.35 mmol), diacetoxypalladium (0.93 mg, 4.1 μmol) and dicyclohexyl(2′,6′-dimethoxybiphenyl-2-yl)phosphine (3.47 mg, 8.45 μmol). Ethanol (1760 μl) and sodium carbonate (176 μl, 0.352 mmol) were added and the mixture was reacted in a microwave reactor at 100° C. for 30 min. The reaction mixture was diluted with dichloromethane, dried over anhydrous sodium sulfate, filtered, and concentrated under reduced pressure. The residue was purified by preparative thin layer chromatography (eluant: 9:1 hexane/ethyl acetate) to provide methyl 5′-fluoro-2′-nitrobiphenyl-2-carboxylate (37a, 54.8 mg, 0.199 mmol, 56.6% yield).

후처리

  1. customthe mixture was reacted in a microwave reactor at 100° C. for 30 min
  2. dry with materialdried over anhydrous sodium sulfate
  3. filtrationfiltered
  4. concentrationconcentrated under reduced pressure
  5. customThe residue was purified by preparative thin layer chromatography (eluant: 9:1 hexane/ethyl acetate)

출처 및 근거

ORD 기록
ord-de5216e5a08342268e6cdce9a3e4ecd9
출처 데이터셋
uspto-grants-2016_04
특허 번호
US09309279B2

연결된 노트

불러오는 중…