N-bromobutanimide → 4-Bromomethyl-4'-nitrobenzophenone

HRID 634800노트

반응식

HRID 634800 반응식
[CH3:1][C:2]1[CH:18]=[CH:17][C:5]([C:6]([C:8]2[CH:13]=[CH:12][C:11]([N+:14]([O-:16])=[O:15])=[CH:10][CH:9]=2)=[O:7])=[CH:4][CH:3]=1.[Br:19]N1C(=O)CCC1=O>C(Cl)(Cl)(Cl)Cl.C(OOC(=O)C1C=CC=CC=1)(=O)C1C=CC=CC=1>[Br:19][CH2:1][C:2]1[CH:3]=[CH:4][C:5]([C:6]([C:8]2[CH:13]=[CH:12][C:11]([N+:14]([O-:16])=[O:15])=[CH:10][CH:9]=2)=[O:7])=[CH:17][CH:18]=1

참가 물질

5

반응물 2

HCID 67184N-bromobutanimideHCID 2191314-Methyl-4'-nitrobenzophenone

생성물 1

HCID 143775484-Bromomethyl-4'-nitrobenzophenone수율 112.4%

시약·촉매·용매 2

HCID 7187Benzoyl Peroxide촉매HCID 5943Carbon Tetrachloride용매

실험 절차

Benzoyl peroxide (0.012 g) was added to a mixture of 4-(4-methylbenzoyl)-nitrobenzene (1.20 g) and N-bromosuccinimide (0.89 g) suspended in carbon tetrachloride (63 mL). The reaction mixture was refluxed under argon for 4 hours while illuminated with an incandescent lamp. The mixture was filtered, and the yellow solution containing the crude product was evaporated, chromatographed on silica gel, eluting with hexane/ethyl acetate, to give 4-(4-bromomethylbenzoyl)-nitrobenzene (1.79 g, 81%) as a white solid, m.p. 112.7-113.1° C.

후처리

  1. temperatureThe reaction mixture was refluxed under argon for 4 hours
  2. customwhile illuminated with an incandescent lamp
  3. filtrationThe mixture was filtered
  4. additionthe yellow solution containing the crude product
  5. customwas evaporated
  6. customchromatographed on silica gel
  7. washeluting with hexane/ethyl acetate

출처 및 근거

ORD 기록
ord-55d16c958f394beb8e9d507948fa47c6
출처 데이터셋
uspto-grants-2001_02
특허 번호
US06184242B2

반응 노트

불러오는 중…