N-Methylolacrylamide → N-hydroxymethyl acrylamide dodecyl acrylate

HRID 65656

반응식

HRID 65656 반응식
[OH:1][CH2:2][NH:3][C:4](=[O:7])[CH:5]=[CH2:6].[C:8]([O:12][CH2:13][CH2:14][CH2:15][CH2:16][CH2:17][CH2:18][CH2:19][CH2:20][CH2:21][CH2:22][CH2:23][CH3:24])(=[O:11])[CH:9]=[CH2:10]>C(C(C)=O)C.C(OOC(=O)C1C=CC=CC=1)(=O)C1C=CC=CC=1>[OH:1][CH2:2][NH:3][C:4](=[O:7])[CH:5]=[CH2:6].[C:8]([O:12][CH2:13][CH2:14][CH2:15][CH2:16][CH2:17][CH2:18][CH2:19][CH2:20][CH2:21][CH2:22][CH2:23][CH3:24])(=[O:11])[CH:9]=[CH2:10]

참가 물질

5

반응물 2

HCID 13543N-MethylolacrylamideHCID 75084Lauryl acrylate

생성물 1

HCID 86736188N-hydroxymethyl acrylamide dodecyl acrylate수율 430.5%

시약·촉매·용매 2

HCID 7187Benzoyl Peroxide촉매HCID 6569Methyl Ethyl Ketone용매

반응 조건

온도
80 °C

실험 절차

10.1 gm (0.1 mole) of N-hydroxymethyl acrylamide and 144 gm (0.6 mole) of dodecyl acrylate were dissolved in 360 gm of methyl ethyl ketone. To the solution obtained were added 3.1 gm of dibenzoyl peroxide as a catalyst. The reaction mixture was maintained for 5 hours under stirring at a temperature of 80° C. After the reaction was completed, the solvent was distilled off and the reaction product washed several times with methanol. 147 gm (95% of theory) of N-hydroxymethyl acrylamide/dodecyl acrylate copolymer (1:6 molar ratio) were obtained.

후처리

  1. customTo the solution obtained
  2. temperatureThe reaction mixture was maintained for 5 hours
  3. distillationthe solvent was distilled off
  4. washthe reaction product washed several times with methanol

출처 및 근거

ORD 기록
ord-c9f8f0cc0f7d41979aea8df5c5aeb86b
출처 데이터셋
uspto-grants-1978_12
특허 번호
US04128634

연결된 노트

불러오는 중…