Dichloromethane → 1-(2-Methylphenyl)-6-methylpyrrolo[3,2-c]cinnoline

HRID 704573

반응식

HRID 704573 반응식
[CH3:1][C:2]1[CH:7]=[CH:6][CH:5]=[CH:4][C:3]=1[N:8]1[C:20]2[C:19]3[CH:18]=[CH:17][CH:16]=[C:15]([CH3:21])[C:14]=3[N:13]=[N:12][C:11]=2[CH2:10][CH2:9]1.ClCCl>C1(OC2C=CC=CC=2)C=CC=CC=1.C(Cl)(Cl)Cl.[Pd]>[CH3:1][C:2]1[CH:7]=[CH:6][CH:5]=[CH:4][C:3]=1[N:8]1[C:20]2[C:19]3[CH:18]=[CH:17][CH:16]=[C:15]([CH3:21])[C:14]=3[N:13]=[N:12][C:11]=2[CH:10]=[CH:9]1

참가 물질

6

반응물 2

HCID 6344DichloromethaneHCID 200727571-(2-Methylphenyl)-6-methyl-2,3-dihydropyrrolo [3,2-c]cinnoline

생성물 1

HCID 200727541-(2-Methylphenyl)-6-methylpyrrolo[3,2-c]cinnoline

시약·촉매·용매 3

HCID 23938Palladium촉매HCID 6212Chloroform용매2회HCID 7583Diphenyl Ether용매

실험 절차

To a refluxing slurry of 10% Pd/C (0.4 g) in diphenyl ether (20 ml) was added 1-(2-methylphenyl)-6-methyl-2,3-dihydropyrrolo [3,2-c]cinnoline (1.25 g, 0.0045 mol). After 0.5 hour at reflux temperature the reaction mixture was cooled, diluted with chloroform and the catalyst was filtered off over hyflo. The product was isolated by column chromatography using dichloromethane (11) then chloroform. The oil obtained was crystallized from ethyl acetate, 0.42 g, m.p. 105-106°.

후처리

  1. temperatureAfter 0.5 hour at reflux temperature the reaction mixture
  2. temperaturewas cooled
  3. filtrationthe catalyst was filtered off over hyflo
  4. customThe product was isolated by column chromatography
  5. customThe oil obtained
  6. customwas crystallized from ethyl acetate, 0.42 g, m.p. 105-106°

출처 및 근거

ORD 기록
ord-c6ddbe0469dc4c2e99913a8c9ed2a0f2
출처 데이터셋
uspto-grants-1991_01
특허 번호
US04988695

연결된 노트

불러오는 중…