Triethylamine → 4-Hydroxy-3-methoxy-n-[3-[2-(2-trifluoromethylphenyl)ethynyl]phenyl]phenylacetamide

HRID 7067

반응식

HRID 7067 반응식
[C:1]([C:3]1[CH:4]=[C:5]([NH:9][C:10](=[O:21])[CH2:11][C:12]2[CH:17]=[CH:16][C:15]([OH:18])=[C:14]([O:19][CH3:20])[CH:13]=2)[CH:6]=[CH:7][CH:8]=1)#[CH:2].[F:22][C:23]([F:32])([F:31])[C:24]1[CH:29]=[CH:28][CH:27]=[CH:26][C:25]=1I.C(N(CC)CC)C>[Cu]I.C1(C=CC=CC=1)[P](C1C=CC=CC=1)(C1C=CC=CC=1)[Pd][P](C1C=CC=CC=1)(C1C=CC=CC=1)C1C=CC=CC=1.C(#N)C>[OH:18][C:15]1[CH:16]=[CH:17][C:12]([CH2:11][C:10]([NH:9][C:5]2[CH:6]=[CH:7][CH:8]=[C:3]([C:1]#[C:2][C:25]3[CH:26]=[CH:27][CH:28]=[CH:29][C:24]=3[C:23]([F:32])([F:31])[F:22])[CH:4]=2)=[O:21])=[CH:13][C:14]=1[O:19][CH3:20]

참가 물질

7

반응물 3

HCID 8471TriethylamineHCID 67957Benzene, 1-iodo-2-(trifluoromethyl)-HCID 86760178N-(3-ethynylphenyl)-4-hydroxy-3-methoxyphenyacetamide

생성물 1

HCID 120966634-Hydroxy-3-methoxy-n-[3-[2-(2-trifluoromethylphenyl)ethynyl]phenyl]phenylacetamide

시약·촉매·용매 3

HCID 24350Copper(1+) iodide; Copper(I) iodide; Cuprous iodide; Cuprous iodide (CuI)촉매HCID 178419050HCID 178419050, 화합물촉매HCID 6342Acetonitrile용매

반응 조건

온도
50 °C

실험 절차

A mixture of N-(3-ethynylphenyl)-4-hydroxy-3-methoxypheny-acetamide (the compound of Example 19) (200 mg), 1-trifluoromethyl-2-iodobenzene (280 mg), copper (I) iodide (19 mg), bis(triphenylphosphine)palladium (II) dichloride (70 mg), triethylamine (1 g) and acetonitrile (3 ml) is heated with stirring at 50° C. under argon atmosphere for 18 hours. The solvent is evaporated under reduced pressure, and the residue is purified by silica gel column chromatography (eluent: gradient from 0% to 100% hexane/ethyl acetate) to give the desired compound (120 mg).

후처리

  1. temperatureis heated
  2. customThe solvent is evaporated under reduced pressure
  3. customthe residue is purified by silica gel column chromatography (eluent: gradient from 0% to 100% hexane/ethyl acetate)

출처 및 근거

ORD 기록
ord-b5a3ba4d153e4ab996f6b3ba98b5134c
출처 데이터셋
uspto-grants-2006_08
특허 번호
US07084176B2

연결된 노트

불러오는 중…