Acetic Acid → (3,4,5-Trifluoro-2-hydroxyphenyl)acetic acid

HRID 71217노트

반응식

HRID 71217 반응식
[F:1][C:2]1[C:3]([OH:13])=[C:4](C(=O)C)[CH:5]=[C:6]([F:9])[C:7]=1[F:8].N1CCOCC1.[S].Cl.[C:22]([OH:25])(=[O:24])[CH3:23]>O.C1(C)C=CC(S(O)(=O)=O)=CC=1>[F:1][C:2]1[C:3]([OH:13])=[C:4]([CH2:23][C:22]([OH:25])=[O:24])[CH:5]=[C:6]([F:9])[C:7]=1[F:8]

참가 물질

7

반응물 5

HCID 176Acetic AcidHCID 313Hydrochloric AcidHCID 8083MorpholineHCID 5362487SulfurHCID 833972091-(3,4,5-Trifluoro-2-hydroxyphenyl)ethanone

생성물 1

HCID 84673812(3,4,5-Trifluoro-2-hydroxyphenyl)acetic acid

시약·촉매·용매 1

HCID 521998p-Toluenesulfonic acid monohydrate촉매

반응 조건

온도
120 °C

실험 절차

A mixture of 1-(3,4,5-trifluoro-2-hydroxyphenyl)ethanone (7.5 g), p-toluenesulfonic acid monohydrate (0.375 g), morpholine (10 mL) and sulfur (2.0 g) was stirred at 120° C. for 5 hr, and allowed to cool to room temperature, and hydrochloric acid (20 mL) and acetic acid (20 mL) were added to the reaction mixture. The reaction mixture was stirred at 100° C. for 3 hr, allowed to cool to room temperature, and extracted with ethyl acetate. The extract was washed with saturated brine, and dried over anhydrous magnesium sulfate, and the solvent was evaporated under reduced pressure. The residue was purified by silica gel column chromatography (ethyl acetate/hexane) to give the title compound (6.0 g).

후처리

  1. temperatureto cool to room temperature
  2. stirringThe reaction mixture was stirred at 100° C. for 3 hr
  3. temperatureto cool to room temperature
  4. extractionextracted with ethyl acetate
  5. washThe extract was washed with saturated brine
  6. dry with materialdried over anhydrous magnesium sulfate
  7. customthe solvent was evaporated under reduced pressure
  8. customThe residue was purified by silica gel column chromatography (ethyl acetate/hexane)

출처 및 근거

ORD 기록
ord-fcd1fc34450442c0826d4632225c6ab5
출처 데이터셋
uspto-grants-2014_09
특허 번호
US08822699B2

반응 노트

불러오는 중…