Dichloromethane → 1-Methoxy-1,3,3-trimethylurea

HRID 82744

반응식

HRID 82744 반응식
Cl.[CH3:2][N:3](C)[OH:4].Cl[CH2:7]Cl.[CH3:9][N:10]([CH3:14])[C:11](Cl)=[O:12]>CN(C)C1C=CN=CC=1.N1C=CC=CC=1>[CH3:7][O:4][N:3]([CH3:2])[C:11]([N:10]([CH3:14])[CH3:9])=[O:12]

참가 물질

6

반응물 3

HCID 6344DichloromethaneHCID 6598Dimethylcarbamoyl ChlorideHCID 27969N,N-dimethylhydroxylamine hydrochloride

생성물 1

HCID 51693531-Methoxy-1,3,3-trimethylurea수율 69%

시약·촉매·용매 2

HCID 142844-(Dimethylamino)pyridine촉매HCID 1049Pyridine용매

반응 조건

온도
-20 °C

실험 절차

A mixture of dimethylhydroxylamine hydrochloride (150.0 g, 1.54 mol), 4-dimethylaminopyridine (9.4 g, 0.076 mol), and dichloromethane (1.35 L) was chilled to −20° C., under argon. Dimethylcarbamyl chloride (135 ml, 1.46 mol) and pyridine (315 ml) were added consecutively over 25 minutes. The reaction was slowly warmed to room temperature over 2 hours, and agitated for about 16 hours. The reaction mixture was filtered to remove pyridine hydrochloride, and concentrated by rotary evaporator. The mixture was diluted with t-butyl methyl ether (500 ml), and the solids were removed by filtration. The filtrate was concentrated by rotary evaporation. Vacuum distillation provided the desired product (135.10 g, 69%) as a colorless oil.

후처리

  1. temperatureThe reaction was slowly warmed to room temperature over 2 hours
  2. filtrationThe reaction mixture was filtered
  3. customto remove pyridine hydrochloride
  4. concentrationconcentrated by rotary evaporator
  5. additionThe mixture was diluted with t-butyl methyl ether (500 ml)
  6. customthe solids were removed by filtration
  7. concentrationThe filtrate was concentrated by rotary evaporation
  8. distillationVacuum distillation

출처 및 근거

ORD 기록
ord-de95aab7108642a585d004ea6ce263c2
출처 데이터셋
uspto-grants-2014_09
특허 번호
US08846735B2

연결된 노트

불러오는 중…