Dihydrocholesterol → 3-Oxocholestane

HRID 842495

반응식

HRID 842495 반응식
[CH3:1][C@@H:2]([C@@H:9]1[C@@:13]2([CH3:28])[CH2:14][CH2:15][C@@H:16]3[C@@:21]4([CH3:27])[CH2:22][CH2:23][C@H:24]([OH:26])[CH2:25][C@@H:20]4[CH2:19][CH2:18][C@H:17]3[C@@H:12]2[CH2:11][CH2:10]1)[CH2:3][CH2:4][CH2:5][CH:6]([CH3:8])[CH3:7]>C(OCC)C.[Os](=O)(=O)(=O)=O>[CH3:8][CH:6]([CH2:5][CH2:4][CH2:3][C@H:2]([C@@H:9]1[C@:13]2([CH3:28])[C@H:12]([C@H:17]3[C@H:16]([CH2:15][CH2:14]2)[C@:21]2([CH3:27])[CH:20]([CH2:25][C:24](=[O:26])[CH2:23][CH2:22]2)[CH2:19][CH2:18]3)[CH2:11][CH2:10]1)[CH3:1])[CH3:7]

참가 물질

4

반응물 1

HCID 6665Dihydrocholesterol

생성물 1

HCID 108835733-Oxocholestane수율 90%

시약·촉매·용매 2

HCID 30318Osmium Tetroxide촉매HCID 3283Diethyl Ether용매

반응 조건

온도
25 °C

실험 절차

2.5 Millimole of 3β-cholestanol was dissolved in 50 ml of diethyl ether, and MCOsOx containing osmium tetroxide in an amount equivalent to 2.5 mmol was added thereto, followed by stirring at 25° C. for 30 hours to cause a reaction to take place. MCOsOx was removed from the reaction solution, and a crude keto compound was recovered from the filtrate and purified by silica gel column chromatography (eluent:benzene) to give 3-cholestanon at a yield of 90%.

후처리

  1. additionwas added
  2. customa reaction
  3. customMCOsOx was removed from the reaction solution
  4. customa crude keto compound was recovered from the filtrate
  5. custompurified by silica gel column chromatography (eluent:benzene)

출처 및 근거

ORD 기록
ord-494ce304ac974530a2dfaf1a4fa9e2dd
출처 데이터셋
uspto-grants-2002_04
특허 번호
US06376419B1

연결된 노트

불러오는 중…