Acetic Anhydride → HCID 14984434, 화합물

HRID 868773

반응식

HRID 868773 반응식
[C:1]([O:6][CH2:7][CH2:8][CH2:9][CH3:10])(=[O:5])[C:2]([CH3:4])=[O:3].[C:11](OC(=O)C)(=[O:13])[CH3:12]>O.C1(C)C=CC(S(O)(=O)=O)=CC=1.C(O)(=O)C>[C:11]([O:3][C:2](=[CH2:4])[C:1]([O:6][CH2:7][CH2:8][CH2:9][CH3:10])=[O:5])(=[O:13])[CH3:12]

참가 물질

5

반응물 2

HCID 7918Acetic Anhydride2회HCID 523883Butyl pyruvate

생성물 1

HCID 14984434HCID 14984434, 화합물수율 67.1%

시약·촉매·용매 2

HCID 521998p-Toluenesulfonic acid monohydrate촉매HCID 176Acetic Acid용매

반응 조건

온도
120 °C

실험 절차

Next, in a mixture of the obtained butyl pyruvate (235 g, 1.6 mol) and acetic anhydride (333 g, 3.3 mol), p-toluenesulfonic acid monohydrate (5 g) was added. Then, the mixture was stirred under a nitrogen gas stream at 120° C. for 25 hours to obtain a second reaction solution. Next, acetic acid generated by a reaction with excess acetic anhydride under reduced pressure (5 mmHg) was removed from the second reaction solution. Thereafter, the residue was purified by reduced pressure distillation (2 mmHg, 56 to 63° C.) to obtain butyl α-acetoxyacrylate (200 g, yield 67%).

후처리

  1. additionwas added
  2. customto obtain a second reaction solution
  3. customwas removed from the second reaction solution
  4. distillationThereafter, the residue was purified by reduced pressure distillation (2 mmHg, 56 to 63° C.)

출처 및 근거

ORD 기록
ord-c044d2a1fa244dfd88caa39a2fce939c
출처 데이터셋
uspto-grants-2015_03
특허 번호
US08968975B2

연결된 노트

불러오는 중…