Potassium Carbonate → 1,3,5-Tris(n-(4-biphenylyl)-n-(1-naphthyl)amino)benzene

HRID 917001

반응식

HRID 917001 반응식
[C:1]1([NH:11][C:12]2[CH:17]=[C:16]([NH:18][C:19]3[C:28]4[C:23](=[CH:24][CH:25]=[CH:26][CH:27]=4)[CH:22]=[CH:21][CH:20]=3)[CH:15]=[C:14]([NH:29][C:30]3[C:39]4[C:34](=[CH:35][CH:36]=[CH:37][CH:38]=4)[CH:33]=[CH:32][CH:31]=3)[CH:13]=2)[C:10]2[C:5](=[CH:6][CH:7]=[CH:8][CH:9]=2)[CH:4]=[CH:3][CH:2]=1.I[C:41]1[CH:46]=[CH:45][C:44]([C:47]2[CH:52]=[CH:51][CH:50]=[CH:49][CH:48]=2)=[CH:43][CH:42]=1.C(=O)([O-])[O-].[K+].[K+].C1O[CH2:75][CH2:74]OCCOCCOCCOCCOC1>[Cu].C1(C)C=C(C)C=C(C)C=1>[C:44]1([C:47]2[CH:52]=[CH:51][CH:50]=[CH:49][CH:48]=2)[CH:45]=[CH:46][C:41]([N:11]([C:12]2[CH:13]=[C:14]([N:29]([C:30]3[C:39]4[C:34](=[CH:35][CH:36]=[CH:37][CH:38]=4)[CH:33]=[CH:32][CH:31]=3)[C:50]3[CH:51]=[CH:52][C:47]([C:44]4[CH:45]=[CH:46][CH:41]=[CH:42][CH:43]=4)=[CH:48][CH:49]=3)[CH:15]=[C:16]([N:18]([C:19]3[C:28]4[C:23](=[CH:24][CH:25]=[CH:26][CH:27]=4)[CH:22]=[CH:21][CH:20]=3)[C:1]3[CH:10]=[CH:5][C:4]([C:75]4[CH:74]=[CH:9][CH:8]=[CH:7][CH:6]=4)=[CH:3][CH:2]=3)[CH:17]=2)[C:1]2[C:10]3[C:5](=[CH:6][CH:7]=[CH:8][CH:9]=3)[CH:4]=[CH:3][CH:2]=2)=[CH:42][CH:43]=1

참가 물질

7

반응물 4

HCID 11430Potassium CarbonateHCID 153224-IodobiphenylHCID 2855718-Crown-62회HCID 231397241,3,5-Tris(l-naphthylamino)benzene

생성물 1

HCID 231397251,3,5-Tris(n-(4-biphenylyl)-n-(1-naphthyl)amino)benzene수율 110.3%

시약·촉매·용매 2

HCID 23978Copper촉매HCID 7947Mesitylene용매

실험 절차

2.0 g of 1,3,5-tris(1-naphthylamino)benzene, 5.0 g of 4-iodobiphenyl, 3.7 g of potassium carbonate, 2 g of copper powder, 0.3 g of 18-crown-6 (or 1,4,7,10,13,16-hexaoxacyclooctadecane) and 10 mL of mesitylene as a reaction solvent were placed in a 100 mL capacity glass flask and the reaction was carried out at a temperature of 170° C. for 17 hours under a nitrogen atmosphere. After the reaction, the resultant reaction mixture was extracted with toluene and the toluene solution was subjected to silica gel chromatography to fractionate the reaction product. The reaction product was then purified by recrystallization from a mixed solvent of toluene/hexane and then by sublimation to provide 1.2 g of the desired 1,3,5-tris(N-(4-biphenylyl)-N-(1-naphthyl)amino)benzene (TBNAB). The yield was 32%.

후처리

  1. customAfter the reaction
  2. customthe resultant reaction mixture
  3. extractionwas extracted with toluene
  4. customThe reaction product was then purified by recrystallization from a mixed solvent of toluene/hexane

출처 및 근거

ORD 기록
ord-8fc0f2e29120456e8994531a6e7e75d7
출처 데이터셋
uspto-grants-2007_09
특허 번호
US07271291B2

연결된 노트

불러오는 중…