Carbazole → 9-(2-Bromophenyl)-9H-carbazole

HRID 923701

반응식

HRID 923701 반응식
[CH:1]1[C:13]2[NH:12][C:11]3[C:6](=[CH:7][CH:8]=[CH:9][CH:10]=3)[C:5]=2[CH:4]=[CH:3][CH:2]=1.[Br:14][C:15]1[CH:20]=[CH:19][CH:18]=[CH:17][C:16]=1I.C(=O)([O-])[O-].[K+].[K+]>[Cu](I)I.C1(C)C(C)=CC=CC=1>[Br:14][C:15]1[CH:20]=[CH:19][CH:18]=[CH:17][C:16]=1[N:12]1[C:11]2[CH:10]=[CH:9][CH:8]=[CH:7][C:6]=2[C:5]2[C:13]1=[CH:1][CH:2]=[CH:3][CH:4]=2

참가 물질

6

반응물 3

HCID 6854CarbazoleHCID 114151-Bromo-2-iodobenzeneHCID 11430Potassium Carbonate

생성물 1

HCID 594650129-(2-Bromophenyl)-9H-carbazole

시약·촉매·용매 2

HCID 83717Copper iodide촉매HCID 7237O-Xylene용매

실험 절차

1.672 g of carbazole, 1.6 mL of 1-bromo-2-iodobenzene, 2.7646 g of potassium carbonate, 95 mg of copper iodide and 25 mL of xylene were refluxed in a nitrogen atmosphere. The mixture was cooled to room temperature, extracted with ethyl acetate, and dried with anhydrous magnesium sulfate to remove moisture, and the solvent was removed under reduced pressure. Silica gel column separation using a hexane solvent was conducted, thus obtaining a compound from which the solvent was then removed under reduced pressure, followed by vacuum drying, yielding 9-(2-bromophenyl)-9H-carbazole as a desired white solid intermediate.

후처리

  1. extractionextracted with ethyl acetate
  2. dry with materialdried with anhydrous magnesium sulfate
  3. customto remove moisture
  4. customthe solvent was removed under reduced pressure
  5. customSilica gel column separation
  6. customthus obtaining a compound from which the solvent
  7. customwas then removed under reduced pressure
  8. customdrying

출처 및 근거

ORD 기록
ord-93dd3badfbed48a3b8590f7df6e018d2
출처 데이터셋
uspto-grants-2016_03
특허 번호
US09278986B2

연결된 노트

불러오는 중…