5-((3-Bromophenylamino)methylene)-2,2-di-methyl-1,3-dioxane-4,6-dione → 5-Bromoquinolin-4-ol

HRID 9474

반응식

HRID 9474 반응식
[Br:1][C:2]1[CH:3]=[C:4]([NH:8][CH:9]=[C:10]2[C:15](=[O:16])OC(C)(C)OC2=O)[CH:5]=[CH:6][CH:7]=1>C1C=CC(C2C=CC=CC=2)=CC=1.C1C=CC(OC2C=CC=CC=2)=CC=1>[Br:1][C:2]1[CH:3]=[C:4]2[C:5]([C:15]([OH:16])=[CH:10][CH:9]=[N:8]2)=[CH:6][CH:7]=1.[Br:1][C:2]1[CH:7]=[CH:6][CH:5]=[C:4]2[C:3]=1[C:15]([OH:16])=[CH:10][CH:9]=[N:8]2

참가 물질

4

반응물 1

HCID 172522195-((3-Bromophenylamino)methylene)-2,2-di-methyl-1,3-dioxane-4,6-dione

생성물 2

HCID 1784187245-Bromoquinolin-4-olHCID 178418765HCID 178418765, 화합물

시약·촉매·용매 1

HCID 246701,1'-Biphenyl, mixt. with 1,1'-oxybis(benzene)용매

실험 절차

5-[(3-Bromophenylamino)methylene]-2,2-dimethyl-[1,3]dioxane-4,6-dione (32.6 g, 0.100 mol) was heated at 250° C. in DOWTHERM A heat transfer fluid for one hour, and then the reaction was allowed to cool to ambient temperature. A precipitate formed upon cooling and was isolated by filtration and washed with diethyl ether to provide 7-bromoquinolin-4-ol and 5-bromoquinolin-4-ol in a 2:1 ratio.

후처리

  1. temperatureheat transfer fluid for one hour
  2. customA precipitate formed
  3. temperatureupon cooling
  4. customwas isolated by filtration
  5. washwashed with diethyl ether

출처 및 근거

ORD 기록
ord-b1f865ef25a04e39839832f0be237929
출처 데이터셋
uspto-grants-2006_08
특허 번호
US07091214B2

연결된 노트

불러오는 중…