1,2-Dichloroethane → 1,1-Cyclopropanedicarboxylic acid, 1,1-dimethyl ester

HRID 991261

반응식

HRID 991261 반응식
Cl[CH2:2][CH2:3]Cl.CC(CC(O)CO)C.C(=O)([O-])[O-].[K+].[K+].[C:19]([O:26][CH3:27])(=[O:25])[CH2:20][C:21]([O:23][CH3:24])=[O:22]>[Br-].C([N+](CCCC)(CCCC)CCCC)CCC.O>[C:20]1([C:19]([O:26][CH3:27])=[O:25])([C:21]([O:23][CH3:24])=[O:22])[CH2:3][CH2:2]1

참가 물질

7

반응물 4

HCID 111,2-Dichloroethane2회HCID 7943Dimethyl malonateHCID 11430Potassium CarbonateHCID 911714-Methylpentane-1,2-diol

생성물 1

HCID 27695391,1-Cyclopropanedicarboxylic acid, 1,1-dimethyl ester수율 96.3%

시약·촉매·용매 2

HCID 74236Tetrabutylammonium Bromide촉매HCID 962Water용매

실험 절차

450.3 g of 1,2-dichloroethane (4.55 mol), 15.5 g of polyethylene glycol dimethyl ether (mean molar mass 250 g/mol) and 168.0 g of potassium carbonate (1.2 mol) were initially introduced, and the reaction mixture was heated until the 1,2-dichloroethane refluxes. 118.9 g of dimethyl malonate (0.9 mol) and 1.25 g of tetrabutylammonium bromide (3.88 mmol) were then added at the boil. The mixture was stirred using a finely dispersing stirrer (Ultra Turrax) for 6 hours. Water formed during the reaction was removed by azeotropic distillation with 1,2-dichloroethane throughout the reaction. Further work-up was carried out analogously to Comparative Example 2. The yield was 96.3%.

후처리

  1. additiona finely dispersing stirrer (Ultra Turrax) for 6 hours
  2. customwas removed by azeotropic distillation with 1,2-dichloroethane throughout the reaction

출처 및 근거

ORD 기록
ord-1c99b871a71c46c6bb89c2767bc3272b
출처 데이터셋
uspto-grants-2002_10
특허 번호
US06462224B2

연결된 노트

불러오는 중…