p-Nitroacetophenone → HCID 88069650, 화합물

HRID 991557노트

반응식

HRID 991557 반응식
[Cl:1][C:2]1[C:7]([C:8]([NH:10][CH2:11][C:12]([OH:14])=[O:13])=O)=[CH:6][CH:5]=[CH:4][N:3]=1.[CH3:15][C:16]([C:18]1[CH:23]=[CH:22][C:21]([N+:24]([O-:26])=[O:25])=[CH:20][CH:19]=1)=O.C([O-])(=O)C.[Pb+4].C([O-])(=O)C.C([O-])(=O)C.C([O-])(=O)C.C(OC(=O)C)(=O)C>C1COCC1>[Cl:1][C:2]1[C:7]([C:8]2[O:14][C:12](=[O:13])/[C:11](=[C:16](/[C:18]3[CH:19]=[CH:20][C:21]([N+:24]([O-:26])=[O:25])=[CH:22][CH:23]=3)\[CH3:15])/[N:10]=2)=[CH:6][CH:5]=[CH:4][N:3]=1

참가 물질

6

반응물 4

HCID 7487p-NitroacetophenoneHCID 7918Acetic AnhydrideHCID 53558Glycine, N-(2-chloronicotinoyl)-HCID 178418268HCID 178418268, 화합물

생성물 1

HCID 88069650HCID 88069650, 화합물수율 20.8%

시약·촉매·용매 1

HCID 8028Tetrahydrofuran용매

실험 절차

A mixture of 2-{[(2-chloro-3-pyridinyl)carbonyl]amino}acetic acid (6.44 g, 30 mmol, prepared from glycine and 2-chloronicotinoyl chloride), 4-nitroacetophenone (2.48 g, 15 mmol), lead (IV) acetate (3.33 g, 7.5 mmol) and acetic anhydride in THF (30 ml) was heated at reflux for 4 days. The mixture was poured onto crushed ice, the solid filtered off, washed with water and dried. The brown solid was triturated twice with boiling ethanol and filtered off to give the title compound as a brown solid (1.07 g). δH (CDCl3), 8.57 (1H, dd, J 4.8, 2.1 Hz, PyH), 8.34-8,29 (3H, m, ArH+PyH), 8.05 (2H, d, J 9.1 Hz, ArH), 7.41 (1H, dd, J 7.9, 4.8 Hz, PyH) and 2.84 (3H, s, Me).

후처리

  1. temperaturewas heated
  2. temperatureat reflux for 4 days
  3. additionThe mixture was poured
  4. customonto crushed ice
  5. filtrationthe solid filtered off
  6. washwashed with water
  7. customdried
  8. customThe brown solid was triturated twice with boiling ethanol
  9. filtrationfiltered off

출처 및 근거

ORD 기록
ord-4f34db70fe8f424a802c52c2d1c949a8
출처 데이터셋
uspto-grants-2002_10
특허 번호
US06465471B1

반응 노트

불러오는 중…