2,6-Di-tert-butyl-4-methylphenol → 5-(5-Cyanopyrid-3-yl)-3-(N-methylpyrrolidin-3-yl)-1H-indole

HRID 1604280Notes

Reaction equation

HRID 1604280 reaction equation
Br[C:2]1[CH:3]=[C:4]2[C:8](=[CH:9][CH:10]=1)[NH:7][CH:6]=[C:5]2[CH:11]1[CH2:15][CH2:14][N:13]([CH3:16])[CH2:12]1.[C:17]([C:19]1[CH:20]=[C:21]([Sn](C)(C)C)[CH:22]=[N:23][CH:24]=1)#[N:18].[Cl-].[Li+].C(C1C=C(C)C=C(C(C)(C)C)C=1O)(C)(C)C>Cl[Pd](Cl)([P](C1C=CC=CC=1)(C1C=CC=CC=1)C1C=CC=CC=1)[P](C1C=CC=CC=1)(C1C=CC=CC=1)C1C=CC=CC=1.C(N(CC)CC)C>[C:17]([C:19]1[CH:20]=[C:21]([C:2]2[CH:3]=[C:4]3[C:8](=[CH:9][CH:10]=2)[NH:7][CH:6]=[C:5]3[CH:11]2[CH2:15][CH2:14][N:13]([CH3:16])[CH2:12]2)[CH:22]=[N:23][CH:24]=1)#[N:18]

Participants

7

Reactant 4

HCID 314042,6-Di-tert-butyl-4-methylphenolHCID 433294Lithium ChlorideHCID 153262755-bromo-3-(N-methylpyrrolidin-3-yl)1H-indoleHCID 186990455-(Trimethylstannyl)nicotinonitrile

Product 1

HCID 154342745-(5-Cyanopyrid-3-yl)-3-(N-methylpyrrolidin-3-yl)-1H-indoleYield 11.2%

Reagents, catalysts & solvents 2

HCID 178418476HCID 178418476, compoundCatalystHCID 8471TriethylamineSolvent

Procedure

A mixture of 5-bromo-3-(N-methylpyrrolidin-3-yl)-1H-indole (0.500 g, 1.79 mmol), 5-cyano-3-trimethylstannylpyridine (0.525 g, 1.97 mmol, 1.1 eq), bis(triphenylphosphine)palladium(II) chloride (0.628 g, 0.90 mmol, 0.5 eq), triethylamine (1.19 mL, 8.59 mmol, 4.8 eq, lithium chloride (0.235 g, 5.55 mmol, 3.1 eq), and 2,6-di-tert-butyl-4-methylphenol (40 mg) in anhydrous acetontrile (5 mL) was heated at reflux under nitrogen for 20 hours. The resulting reaction mixture was evaporated under reduced pressure, and the residue was column chromatographed using silica gel (approx 50 g) and elution with 9:1:0.1 [methylene chloride/methanol/ammonium hydroxide] to afford the title compound (0.060 g, 0.20 mmol, 11%) as a clear, pale brown oil: LRMS (m/z, relative intensity) 302 (M+, 29), 245 (8), 57 (100); HRMS calculated for C19H18N4 302.1528, found 302.1533.

Workup

  1. temperaturewas heated
  2. temperatureat reflux under nitrogen for 20 hours
  3. customThe resulting reaction mixture
  4. customwas evaporated under reduced pressure
  5. customchromatographed
  6. washsilica gel (approx 50 g) and elution with 9:1:0.1 [methylene chloride/methanol/ammonium hydroxide]

Sources & evidence

ORD record
ord-f4263c8ffe1445dabaaa09f1f5a0e043
Source dataset
uspto-grants-1999_11
Patent number
US05994352

Reaction notes

Loading…