HCID 13179847, compound → HCID 13179848, compound

HRID 1702192Notes

Reaction equation

HRID 1702192 reaction equation
[CH3:1][N:2]1[C:6]([C:7]([OH:9])=[O:8])=[CH:5][C:4]([CH2:10][O:11][C:12]2[CH:17]=[CH:16][CH:15]=[C:14]([CH3:18])[CH:13]=2)=[C:3]1[C:19]([OH:21])=O>FC(F)(F)C(OC(=O)C(F)(F)F)=O>[CH3:1][N:2]1[C:6]([C:7]([OH:9])=[O:8])=[CH:5][C:4]2[CH2:10][O:11][C:12]3[CH:13]=[C:14]([CH3:18])[CH:15]=[CH:16][C:17]=3[C:19](=[O:21])[C:3]1=2

Participants

3

Reactant 1

HCID 13179847HCID 13179847, compound

Product 1

HCID 13179848HCID 13179848, compound

Reagents, catalysts & solvents 1

HCID 9845Trifluoroacetic anhydrideSolvent

Procedure

To a stirred ice-bath cooled portion of trifluoroacetic anhydride (30 ml) was added 1-methyl-3-[(m-methylphenoxy)methyl]pyrrole-2,5-dicarboxylic acid (1.0 g) all at once, the mixture stirred 0.5 hour, the ice-bath removed, and the reaction mixture stirred at room temperature. After ca. 3 hours, trifluoroacetic acid (35 ml) was added, and the mixture allowed to stir at ambient temperature. After three hours the reaction mixture was added to excess stirred ice-water, the aged mixture filtered, washed well with water and dried to give crude 4,10-dihydro-1,7-dimethyl-10-oxo-1H[1]-benzoxepino[4,3-b]pyrrole-2-carboxylic acid.

Workup

  1. customthe ice-bath removed
  2. stirringthe reaction mixture stirred at room temperature
  3. waitAfter ca. 3 hours
  4. additiontrifluoroacetic acid (35 ml) was added
  5. stirringto stir at ambient temperature
  6. additionAfter three hours the reaction mixture was added
  7. stirringto excess stirred ice-water
  8. filtrationthe aged mixture filtered
  9. washwashed well with water
  10. customdried

Sources & evidence

ORD record
ord-c0690f9a1e8a4b20ace2fe81082d2e96
Source dataset
uspto-grants-1983_04
Patent number
US04380645

Reaction notes

Loading…