Water → HCID 13388576, compound

HRID 2164325Notes

Reaction equation

HRID 2164325 reaction equation
[C:1]1([CH2:7][S:8]([C:11]2[CH:16]=[C:15]([CH3:17])[CH:14]=[CH:13][N+:12]=2[O-:18])(=[O:10])=[O:9])[CH:6]=[CH:5][CH:4]=[CH:3][CH:2]=1.[CH2:19](Br)[CH2:20][CH2:21][CH3:22].O>[Cl-].C([N+](CC)(CC)CC)C1C=CC=CC=1.C(Cl)Cl>[C:1]1([CH:7]([S:8]([C:11]2[CH:16]=[C:15]([CH3:17])[CH:14]=[CH:13][N+:12]=2[O-:18])(=[O:10])=[O:9])[CH2:19][CH2:20][CH2:21][CH3:22])[CH:2]=[CH:3][CH:4]=[CH:5][CH:6]=1

Participants

6

Reactant 3

HCID 962WaterHCID 8002Butyl bromideHCID 20406423HCID 20406423, compound

Product 1

HCID 13388576HCID 13388576, compound

Reagents, catalysts & solvents 2

HCID 66133Benzyl triethylammonium chlorideCatalystHCID 6344DichloromethaneSolvent

Procedure

To a 100 ml round bottom, 3-necked flask equipped with thermometer, stirrer, were charged 0.5 g (3.2 mmoles) 2-(phenylmethylsulfonyl)-4-methylpyridine 1-oxide, 10 ml CH2Cl2, 0.05 g benzyltriethylammonium chloride and 0.75 ml n-butyl bromide. Said mixture also contained about 5 mg (0.28 mmoles) of water. Immediately, a dark red color formed while the reaction mixture was kept at about 15° while stirring. With time, the color faded, and after 3 hours reaction time, the product (2-(1-phenylpentylsulfonyl)-4-methylpyridine 1-oxide) was isolated, having a melting range of 120°-122° C. The product structure was confirmed by NMR and IR analysis.

Workup

  1. customTo a 100 ml round bottom, 3-necked flask equipped with thermometer, stirrer
  2. customImmediately, a dark red color formed while the reaction mixture
  3. customwas kept at about 15°
  4. customafter 3 hours reaction time

Sources & evidence

ORD record
ord-51767922a0d24d3fb0e1387607bf7761
Source dataset
uspto-grants-1985_03
Patent number
US04503230

Reaction notes

Loading…